C22H18N4O2 — CID 59358333
methyl 16-(2,6-dimethylphenyl)-2,5,7,10-tetrazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),3,5,8,10,13,15-heptaene-9-carboxylate (PubChem CID 59358333) has the molecular formula C22H18N4O2 and a molecular weight of 370.41 g/mol. Its IUPAC name is methyl 16-(2,6-dimethylphenyl)-2,5,7,10-tetrazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),3,5,8,10,13,15-heptaene-9-carboxylate.
| Compound Name | methyl 16-(2,6-dimethylphenyl)-2,5,7,10-tetrazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),3,5,8,10,13,15-heptaene-9-carboxylate |
|---|---|
| PubChem CID | 59358333 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | methyl 16-(2,6-dimethylphenyl)-2,5,7,10-tetrazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),3,5,8,10,13,15-heptaene-9-carboxylate |
| SMILES | COC(=O)c1cn2c(n1)c1cccc(-c3c(C)cccc3C)c1n1ccnc21 |
| InChI | InChI=1S/C22H18N4O2/c1-13-6-4-7-14(2)18(13)15-8-5-9-16-19(15)25-11-10-23-22(25)26-12-17(21(27)28-3)24-20(16)26/h4-12H,1-3H3 |
| InChIKey | HBBOYKONKRSINP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |