C37H32N4OPt — CID 59358359
2-methyl-12H-imidazo[1,2-f]phenanthridin-12-ide;2-methyl-7-(2-methylbutoxy)-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+) (PubChem CID 59358359) has the molecular formula C37H32N4OPt and a molecular weight of 743.77 g/mol. Its IUPAC name is 2-methyl-12H-imidazo[1,2-f]phenanthridin-12-ide;2-methyl-7-(2-methylbutoxy)-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+).
| Compound Name | 2-methyl-12H-imidazo[1,2-f]phenanthridin-12-ide;2-methyl-7-(2-methylbutoxy)-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+) |
|---|---|
| PubChem CID | 59358359 |
| Molecular Formula | C37H32N4OPt |
| Molecular Weight | 743.77 g/mol |
| Exact Mass | 743.22 |
| IUPAC Name | 2-methyl-12H-imidazo[1,2-f]phenanthridin-12-ide;2-methyl-7-(2-methylbutoxy)-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+) |
| SMILES | CCC(C)COc1ccc2c(c1)c1ccc[c-]c1c1nc(C)cn21.Cc1cn2c3ccccc3c3ccc[c-]c3c2n1.[Pt+2] |
| InChI | InChI=1S/C21H21N2O.C16H11N2.Pt/c1-4-14(2)13-24-16-9-10-20-19(11-16)17-7-5-6-8-18(17)21-22-15(3)12-23(20)21;1-11-10-18-15-9-5-4-7-13(15)12-6-2-3-8-14(12)16(18)17-11;/h5-7,9-12,14H,4,13H2,1-3H3;2-7,9-10H,1H3;/q2*-1;+2 |
| InChIKey | BGZUNCRYWXUZPM-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 43.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.77 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|