About CID 59358444
CID 59358444 (PubChem CID 59358444) has the molecular formula C67H46N6O2PtS2
and a molecular weight of 1226.36 g/mol.
Molecular Properties
| Compound Name | CID 59358444 |
| PubChem CID | 59358444 |
| Molecular Formula | C67H46N6O2PtS2 |
| Molecular Weight | 1226.36 g/mol |
| Exact Mass | 1225.28 |
| IUPAC Name | — |
| SMILES | CCC(COc1ccc(-n2c3ccccc3c3cc(-c4cc5c(s4)c4ccc[c-]c4c4nccn54)ccc32)cc1)OC.[Pt+2].[c-]1cccc2c1c1nccn1c1cc(-c3ccc4c(c3)c3ccccc3n4-c3ccccc3)sc21 |
| InChI | InChI=1S/C36H28N3O2S.C31H18N3S.Pt/c1-3-25(40-2)22-41-26-15-13-24(14-16-26)39-31-11-7-6-8-27(31)30-20-23(12-17-32(30)39)34-21-33-35(42-34)28-9-4-5-10-29(28)36-37-18-19-38(33)36;1-2-8-21(9-3-1)34-26-13-7-6-10-22(26)25-18-20(14-15-27(25)34)29-19-28-30(35-29)23-11-4-5-12-24(23)31-32-16-17-33(28)31;/h4-9,11-21,25H,3,22H2,1-2H3;1-11,13-19H;/q2*-1;+2 |
| InChIKey | LNQKQXCINCSGAR-UHFFFAOYSA-N |
| XLogP | 17.33 |
| TPSA | 62.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 78 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1226.36 |
| LogP ≤ 5 | 17.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 59358444 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59358444?
The IUPAC name of CID 59358444 (CID 59358444) is not available.
What is the SMILES notation for CID 59358444?
The canonical SMILES for CID 59358444 is CCC(COc1ccc(-n2c3ccccc3c3cc(-c4cc5c(s4)c4ccc[c-]c4c4nccn54)ccc32)cc1)OC.[Pt+2].[c-]1cccc2c1c1nccn1c1cc(-c3ccc4c(c3)c3ccccc3n4-c3ccccc3)sc21.
What is the InChIKey of CID 59358444?
The InChIKey is LNQKQXCINCSGAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H28N3O2S.C31H18N3S.Pt/c1-3-25(40-2)22-41-26-15-13-24(14-16-26)39-31-11-7-6-8-27(31)30-20-23(12-17-32(30)39)34-21-33-35(42-34)28-9-4-5-10-29(28)36-37-18-19-38(33)36;1-2-8-21(9-3-1)34-26-13-7-6-10-22(26)25-18-20(14-15-27(25)34)29-19-28-30(35-29)23-11-4-5-12-24(23)31-32-16-17-33(28)31;/h4-9,11-21,25H,3,22H2,1-2H3;1-11,13-19H;/q2*-1;+2.
What are the key properties of CID 59358444?
CID 59358444 has a molecular weight of 1226.36 g/mol, XLogP of 17.33, 9 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59358444 is sourced from PubChem (CID 59358444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).