About CID 59358611
CID 59358611 (PubChem CID 59358611) has the molecular formula C49H28IrN6OS2-2
and a molecular weight of 973.15 g/mol.
Molecular Properties
| Compound Name | CID 59358611 |
| PubChem CID | 59358611 |
| Molecular Formula | C49H28IrN6OS2-2 |
| Molecular Weight | 973.15 g/mol |
| Exact Mass | 973.14 |
| IUPAC Name | — |
| SMILES | [Ir].[c-]1ccccc1-n1cccn1.[c-]1nsc2c3cc(-c4cccc(-n5c6ccccc6c6cc(-c7ccc8oc9ccccc9c8c7)ccc65)c4)sc3c3ccnn3c12 |
| InChI | InChI=1S/C40H21N4OS2.C9H7N2.Ir/c1-3-10-32-27(8-1)29-19-23(24-13-15-37-30(20-24)28-9-2-4-11-36(28)45-37)12-14-33(29)43(32)26-7-5-6-25(18-26)38-21-31-39(46-38)34-16-17-41-44(34)35-22-42-47-40(31)35;1-2-5-9(6-3-1)11-8-4-7-10-11;/h1-21H;1-5,7-8H;/q2*-1; |
| InChIKey | VYVAATITSZVNBQ-UHFFFAOYSA-N |
| XLogP | 12.96 |
| TPSA | 66.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 973.15 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 59358611 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59358611?
The IUPAC name of CID 59358611 (CID 59358611) is not available.
What is the SMILES notation for CID 59358611?
The canonical SMILES for CID 59358611 is [Ir].[c-]1ccccc1-n1cccn1.[c-]1nsc2c3cc(-c4cccc(-n5c6ccccc6c6cc(-c7ccc8oc9ccccc9c8c7)ccc65)c4)sc3c3ccnn3c12.
What is the InChIKey of CID 59358611?
The InChIKey is VYVAATITSZVNBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H21N4OS2.C9H7N2.Ir/c1-3-10-32-27(8-1)29-19-23(24-13-15-37-30(20-24)28-9-2-4-11-36(28)45-37)12-14-33(29)43(32)26-7-5-6-25(18-26)38-21-31-39(46-38)34-16-17-41-44(34)35-22-42-47-40(31)35;1-2-5-9(6-3-1)11-8-4-7-10-11;/h1-21H;1-5,7-8H;/q2*-1;.
What are the key properties of CID 59358611?
CID 59358611 has a molecular weight of 973.15 g/mol, XLogP of 12.96, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59358611 is sourced from PubChem (CID 59358611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).