About CID 59358710
CID 59358710 (PubChem CID 59358710) has the molecular formula C32H17F3IrN3S-
and a molecular weight of 724.79 g/mol.
Molecular Properties
| Compound Name | CID 59358710 |
| PubChem CID | 59358710 |
| Molecular Formula | C32H17F3IrN3S- |
| Molecular Weight | 724.79 g/mol |
| Exact Mass | 725.07 |
| IUPAC Name | — |
| SMILES | FC(F)(F)n1c2ccccc2c2cc(-c3ccc(-c4cn5c6ccccc6c6sc[c-]c6c5n4)cc3)ccc21.[Ir] |
| InChI | InChI=1S/C32H17F3N3S.Ir/c33-32(34,35)38-28-8-4-1-5-22(28)25-17-21(13-14-29(25)38)19-9-11-20(12-10-19)26-18-37-27-7-3-2-6-23(27)30-24(15-16-39-30)31(37)36-26;/h1-14,16-18H;/q-1; |
| InChIKey | PYFZJFGYJSYWKW-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 22.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 724.79 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 59358710 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59358710?
The IUPAC name of CID 59358710 (CID 59358710) is not available.
What is the SMILES notation for CID 59358710?
The canonical SMILES for CID 59358710 is FC(F)(F)n1c2ccccc2c2cc(-c3ccc(-c4cn5c6ccccc6c6sc[c-]c6c5n4)cc3)ccc21.[Ir].
What is the InChIKey of CID 59358710?
The InChIKey is PYFZJFGYJSYWKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H17F3N3S.Ir/c33-32(34,35)38-28-8-4-1-5-22(28)25-17-21(13-14-29(25)38)19-9-11-20(12-10-19)26-18-37-27-7-3-2-6-23(27)30-24(15-16-39-30)31(37)36-26;/h1-14,16-18H;/q-1;.
What are the key properties of CID 59358710?
CID 59358710 has a molecular weight of 724.79 g/mol, XLogP of 9.42, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59358710 is sourced from PubChem (CID 59358710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).