About CID 59358785
CID 59358785 (PubChem CID 59358785) has the molecular formula C61H50IrN6O-2
and a molecular weight of 1075.33 g/mol.
Molecular Properties
| Compound Name | CID 59358785 |
| PubChem CID | 59358785 |
| Molecular Formula | C61H50IrN6O-2 |
| Molecular Weight | 1075.33 g/mol |
| Exact Mass | 1075.37 |
| IUPAC Name | — |
| SMILES | COc1c(-c2ccccc2)cc(C)cc1-c1cc(C)c(-c2cc(C)c3c4ncc[c-]c4c4nccn4c3c2)c(C)c1.Cc1cc(C)c(-c2cc(C)c3c4ncc[c-]c4c4nccn4c3c2)c(C)c1.[Ir] |
| InChI | InChI=1S/C37H30N3O.C24H20N3.Ir/c1-22-16-30(26-10-7-6-8-11-26)36(41-5)31(17-22)27-18-23(2)33(24(3)19-27)28-20-25(4)34-32(21-28)40-15-14-39-37(40)29-12-9-13-38-35(29)34;1-14-10-15(2)21(16(3)11-14)18-12-17(4)22-20(13-18)27-9-8-26-24(27)19-6-5-7-25-23(19)22;/h6-11,13-21H,1-5H3;5,7-13H,1-4H3;/q2*-1; |
| InChIKey | OSTQLBYECWDNGW-UHFFFAOYSA-N |
| XLogP | 14.81 |
| TPSA | 69.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 69 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1075.33 |
| LogP ≤ 5 | 14.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 59358785 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59358785?
The IUPAC name of CID 59358785 (CID 59358785) is not available.
What is the SMILES notation for CID 59358785?
The canonical SMILES for CID 59358785 is COc1c(-c2ccccc2)cc(C)cc1-c1cc(C)c(-c2cc(C)c3c4ncc[c-]c4c4nccn4c3c2)c(C)c1.Cc1cc(C)c(-c2cc(C)c3c4ncc[c-]c4c4nccn4c3c2)c(C)c1.[Ir].
What is the InChIKey of CID 59358785?
The InChIKey is OSTQLBYECWDNGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H30N3O.C24H20N3.Ir/c1-22-16-30(26-10-7-6-8-11-26)36(41-5)31(17-22)27-18-23(2)33(24(3)19-27)28-20-25(4)34-32(21-28)40-15-14-39-37(40)29-12-9-13-38-35(29)34;1-14-10-15(2)21(16(3)11-14)18-12-17(4)22-20(13-18)27-9-8-26-24(27)19-6-5-7-25-23(19)22;/h6-11,13-21H,1-5H3;5,7-13H,1-4H3;/q2*-1;.
What are the key properties of CID 59358785?
CID 59358785 has a molecular weight of 1075.33 g/mol, XLogP of 14.81, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59358785 is sourced from PubChem (CID 59358785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).