About CID 59358798
CID 59358798 (PubChem CID 59358798) has the molecular formula C31H22IrN5S-
and a molecular weight of 688.84 g/mol.
Molecular Properties
| Compound Name | CID 59358798 |
| PubChem CID | 59358798 |
| Molecular Formula | C31H22IrN5S- |
| Molecular Weight | 688.84 g/mol |
| Exact Mass | 689.12 |
| IUPAC Name | — |
| SMILES | Cc1nc2c(c3cc(-c4ccc(-n5c6ccccc6c6ccccc65)s4)c[c-]c3c3ncc(C)n32)n1C.[Ir] |
| InChI | InChI=1S/C31H22N5S.Ir/c1-18-17-32-30-23-13-12-20(16-24(23)29-31(35(18)30)33-19(2)34(29)3)27-14-15-28(37-27)36-25-10-6-4-8-21(25)22-9-5-7-11-26(22)36;/h4-12,14-17H,1-3H3;/q-1; |
| InChIKey | YUGAOKVDAMGCQZ-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 688.84 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 59358798 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59358798?
The IUPAC name of CID 59358798 (CID 59358798) is not available.
What is the SMILES notation for CID 59358798?
The canonical SMILES for CID 59358798 is Cc1nc2c(c3cc(-c4ccc(-n5c6ccccc6c6ccccc65)s4)c[c-]c3c3ncc(C)n32)n1C.[Ir].
What is the InChIKey of CID 59358798?
The InChIKey is YUGAOKVDAMGCQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H22N5S.Ir/c1-18-17-32-30-23-13-12-20(16-24(23)29-31(35(18)30)33-19(2)34(29)3)27-14-15-28(37-27)36-25-10-6-4-8-21(25)22-9-5-7-11-26(22)36;/h4-12,14-17H,1-3H3;/q-1;.
What are the key properties of CID 59358798?
CID 59358798 has a molecular weight of 688.84 g/mol, XLogP of 7.61, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59358798 is sourced from PubChem (CID 59358798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).