C26H25N3O2 — CID 59358877
3-[4-(2-methoxybutoxy)phenyl]-14-methyl-3,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),8,10,13,15-octaene (PubChem CID 59358877) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 3-[4-(2-methoxybutoxy)phenyl]-14-methyl-3,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),8,10,13,15-octaene.
| Compound Name | 3-[4-(2-methoxybutoxy)phenyl]-14-methyl-3,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),8,10,13,15-octaene |
|---|---|
| PubChem CID | 59358877 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 3-[4-(2-methoxybutoxy)phenyl]-14-methyl-3,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),8,10,13,15-octaene |
| SMILES | CCC(COc1ccc(-n2cnc3c4cccnc4c4c(C)cccc4c32)cc1)OC |
| InChI | InChI=1S/C26H25N3O2/c1-4-19(30-3)15-31-20-12-10-18(11-13-20)29-16-28-25-22-9-6-14-27-24(22)23-17(2)7-5-8-21(23)26(25)29/h5-14,16,19H,4,15H2,1-3H3 |
| InChIKey | LFGHXQJMIVNJLZ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|