C47H41IrN5-2 — CID 59358919
3-(2,6-dimethylphenyl)-8-(2,5-dimethylpyrrol-1-yl)-11H-pyrazolo[1,5-f]phenanthridin-11-ide;iridium;2-phenyl-1-(2,4,6-trimethylphenyl)imidazole (PubChem CID 59358919) has the molecular formula C47H41IrN5-2 and a molecular weight of 868.10 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)-8-(2,5-dimethylpyrrol-1-yl)-11H-pyrazolo[1,5-f]phenanthridin-11-ide;iridium;2-phenyl-1-(2,4,6-trimethylphenyl)imidazole.
| Compound Name | 3-(2,6-dimethylphenyl)-8-(2,5-dimethylpyrrol-1-yl)-11H-pyrazolo[1,5-f]phenanthridin-11-ide;iridium;2-phenyl-1-(2,4,6-trimethylphenyl)imidazole |
|---|---|
| PubChem CID | 59358919 |
| Molecular Formula | C47H41IrN5-2 |
| Molecular Weight | 868.10 g/mol |
| Exact Mass | 868.30 |
| IUPAC Name | 3-(2,6-dimethylphenyl)-8-(2,5-dimethylpyrrol-1-yl)-11H-pyrazolo[1,5-f]phenanthridin-11-ide;iridium;2-phenyl-1-(2,4,6-trimethylphenyl)imidazole |
| SMILES | Cc1cc(C)c(-n2ccnc2-c2[c-]cccc2)c(C)c1.Cc1cccc(C)c1-c1cnn2c3[c-]ccc(-n4c(C)ccc4C)c3c3ccccc3c12.[Ir] |
| InChI | InChI=1S/C29H24N3.C18H17N2.Ir/c1-18-9-7-10-19(2)27(18)24-17-30-32-26-14-8-13-25(31-20(3)15-16-21(31)4)28(26)22-11-5-6-12-23(22)29(24)32;1-13-11-14(2)17(15(3)12-13)20-10-9-19-18(20)16-7-5-4-6-8-16;/h5-13,15-17H,1-4H3;4-7,9-12H,1-3H3;/q2*-1; |
| InChIKey | YXOAXDZSSQJIFJ-UHFFFAOYSA-N |
| XLogP | 11.39 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.10 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|