About CID 59359015
CID 59359015 (PubChem CID 59359015) has the molecular formula C30H18IrN3OS-
and a molecular weight of 660.78 g/mol.
Molecular Properties
| Compound Name | CID 59359015 |
| PubChem CID | 59359015 |
| Molecular Formula | C30H18IrN3OS- |
| Molecular Weight | 660.78 g/mol |
| Exact Mass | 661.08 |
| IUPAC Name | — |
| SMILES | Cc1cnc2c3[c-]oc(-c4ccccc4)c3c3cc(-n4c5ccccc5c5ccccc54)sc3n12.[Ir] |
| InChI | InChI=1S/C30H18N3OS.Ir/c1-18-16-31-29-23-17-34-28(19-9-3-2-4-10-19)27(23)22-15-26(35-30(22)32(18)29)33-24-13-7-5-11-20(24)21-12-6-8-14-25(21)33;/h2-16H,1H3;/q-1; |
| InChIKey | HQMRXNCPHISPLF-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 35.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 660.78 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 59359015 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59359015?
The IUPAC name of CID 59359015 (CID 59359015) is not available.
What is the SMILES notation for CID 59359015?
The canonical SMILES for CID 59359015 is Cc1cnc2c3[c-]oc(-c4ccccc4)c3c3cc(-n4c5ccccc5c5ccccc54)sc3n12.[Ir].
What is the InChIKey of CID 59359015?
The InChIKey is HQMRXNCPHISPLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H18N3OS.Ir/c1-18-16-31-29-23-17-34-28(19-9-3-2-4-10-19)27(23)22-15-26(35-30(22)32(18)29)33-24-13-7-5-11-20(24)21-12-6-8-14-25(21)33;/h2-16H,1H3;/q-1;.
What are the key properties of CID 59359015?
CID 59359015 has a molecular weight of 660.78 g/mol, XLogP of 8.17, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59359015 is sourced from PubChem (CID 59359015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).