About CID 59359044
CID 59359044 (PubChem CID 59359044) has the molecular formula C43H24IrN3OS-
and a molecular weight of 822.97 g/mol.
Molecular Properties
| Compound Name | CID 59359044 |
| PubChem CID | 59359044 |
| Molecular Formula | C43H24IrN3OS- |
| Molecular Weight | 822.97 g/mol |
| Exact Mass | 823.13 |
| IUPAC Name | — |
| SMILES | [Ir].[c-]1csc2c3cc(-c4cccc(-n5c6ccccc6c6cc(-c7ccc8oc9ccccc9c8c7)ccc65)c4)ccc3c3ccnn3c12 |
| InChI | InChI=1S/C43H24N3OS.Ir/c1-3-10-37-31(8-1)34-23-28(29-14-17-42-35(24-29)33-9-2-4-11-41(33)47-42)13-16-38(34)45(37)30-7-5-6-26(22-30)27-12-15-32-36(25-27)43-40(19-21-48-43)46-39(32)18-20-44-46;/h1-18,20-25H;/q-1; |
| InChIKey | OHNZFCCPWRJIKD-UHFFFAOYSA-N |
| XLogP | 11.83 |
| TPSA | 35.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 822.97 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 59359044 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59359044?
The IUPAC name of CID 59359044 (CID 59359044) is not available.
What is the SMILES notation for CID 59359044?
The canonical SMILES for CID 59359044 is [Ir].[c-]1csc2c3cc(-c4cccc(-n5c6ccccc6c6cc(-c7ccc8oc9ccccc9c8c7)ccc65)c4)ccc3c3ccnn3c12.
What is the InChIKey of CID 59359044?
The InChIKey is OHNZFCCPWRJIKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C43H24N3OS.Ir/c1-3-10-37-31(8-1)34-23-28(29-14-17-42-35(24-29)33-9-2-4-11-41(33)47-42)13-16-38(34)45(37)30-7-5-6-26(22-30)27-12-15-32-36(25-27)43-40(19-21-48-43)46-39(32)18-20-44-46;/h1-18,20-25H;/q-1;.
What are the key properties of CID 59359044?
CID 59359044 has a molecular weight of 822.97 g/mol, XLogP of 11.83, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59359044 is sourced from PubChem (CID 59359044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).