About CID 59359121
CID 59359121 (PubChem CID 59359121) has the molecular formula C52H31IrN5OS-2
and a molecular weight of 966.14 g/mol.
Molecular Properties
| Compound Name | CID 59359121 |
| PubChem CID | 59359121 |
| Molecular Formula | C52H31IrN5OS-2 |
| Molecular Weight | 966.14 g/mol |
| Exact Mass | 966.19 |
| IUPAC Name | — |
| SMILES | [Ir].[c-]1cccc2c3cc(-c4cccc(-n5c6ccccc6c6cc(-c7ccc8oc9ccccc9c8c7)ccc65)c4)sc3c3ccnn3c12.[c-]1ccccc1-n1cccn1 |
| InChI | InChI=1S/C43H24N3OS.C9H7N2.Ir/c1-4-13-36-30(10-1)33-23-26(27-17-19-41-34(24-27)32-12-3-6-15-40(32)47-41)16-18-37(33)45(36)29-9-7-8-28(22-29)42-25-35-31-11-2-5-14-38(31)46-39(20-21-44-46)43(35)48-42;1-2-5-9(6-3-1)11-8-4-7-10-11;/h1-13,15-25H;1-5,7-8H;/q2*-1; |
| InChIKey | XWVAACRFVGHXRZ-UHFFFAOYSA-N |
| XLogP | 13.50 |
| TPSA | 53.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 966.14 |
| LogP ≤ 5 | 13.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 59359121 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59359121?
The IUPAC name of CID 59359121 (CID 59359121) is not available.
What is the SMILES notation for CID 59359121?
The canonical SMILES for CID 59359121 is [Ir].[c-]1cccc2c3cc(-c4cccc(-n5c6ccccc6c6cc(-c7ccc8oc9ccccc9c8c7)ccc65)c4)sc3c3ccnn3c12.[c-]1ccccc1-n1cccn1.
What is the InChIKey of CID 59359121?
The InChIKey is XWVAACRFVGHXRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C43H24N3OS.C9H7N2.Ir/c1-4-13-36-30(10-1)33-23-26(27-17-19-41-34(24-27)32-12-3-6-15-40(32)47-41)16-18-37(33)45(36)29-9-7-8-28(22-29)42-25-35-31-11-2-5-14-38(31)46-39(20-21-44-46)43(35)48-42;1-2-5-9(6-3-1)11-8-4-7-10-11;/h1-13,15-25H;1-5,7-8H;/q2*-1;.
What are the key properties of CID 59359121?
CID 59359121 has a molecular weight of 966.14 g/mol, XLogP of 13.50, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59359121 is sourced from PubChem (CID 59359121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).