C37H21IrN4O2- — CID 59359158
CID 59359158 (PubChem CID 59359158) has the molecular formula C37H21IrN4O2- and a molecular weight of 745.82 g/mol.
| Compound Name | CID 59359158 |
|---|---|
| PubChem CID | 59359158 |
| Molecular Formula | C37H21IrN4O2- |
| Molecular Weight | 745.82 g/mol |
| Exact Mass | 746.13 |
| IUPAC Name | — |
| SMILES | Cc1cnc2c3[c-]cccc3c3oc(-c4ccc5oc6ccc(-n7c8ccccc8c8ccccc87)cc6c5c4)nc3n12.[Ir] |
| InChI | InChI=1S/C37H21N4O2.Ir/c1-21-20-38-35-27-11-3-2-10-26(27)34-36(40(21)35)39-37(43-34)22-14-16-32-28(18-22)29-19-23(15-17-33(29)42-32)41-30-12-6-4-8-24(30)25-9-5-7-13-31(25)41;/h2-10,12-20H,1H3;/q-1; |
| InChIKey | GEQIHQFTNZJEIR-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 61.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.82 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|