C21H15FIrN3S- — CID 59359194
6-fluoro-9,11-dimethyl-2-(1-methylimidazol-2-yl)-4H-phenanthro[9,10-d][1,3]thiazol-4-ide;iridium (PubChem CID 59359194) has the molecular formula C21H15FIrN3S- and a molecular weight of 552.65 g/mol. Its IUPAC name is 6-fluoro-9,11-dimethyl-2-(1-methylimidazol-2-yl)-4H-phenanthro[9,10-d][1,3]thiazol-4-ide;iridium.
| Compound Name | 6-fluoro-9,11-dimethyl-2-(1-methylimidazol-2-yl)-4H-phenanthro[9,10-d][1,3]thiazol-4-ide;iridium |
|---|---|
| PubChem CID | 59359194 |
| Molecular Formula | C21H15FIrN3S- |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 553.06 |
| IUPAC Name | 6-fluoro-9,11-dimethyl-2-(1-methylimidazol-2-yl)-4H-phenanthro[9,10-d][1,3]thiazol-4-ide;iridium |
| SMILES | Cc1cc(C)c2c(c1)c1cc(F)c[c-]c1c1nc(-c3nccn3C)sc12.[Ir] |
| InChI | InChI=1S/C21H15FN3S.Ir/c1-11-8-12(2)17-16(9-11)15-10-13(22)4-5-14(15)18-19(17)26-21(24-18)20-23-6-7-25(20)3;/h4,6-10H,1-3H3;/q-1; |
| InChIKey | WUPKQWIZKYMQRY-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|