C57H39IrN5O-2 — CID 59359270
6-(8-carbazol-9-yldibenzofuran-2-yl)-11H-pyrazolo[1,5-f]phenanthridin-11-ide;iridium;2-phenyl-1-(2,4,6-trimethylphenyl)imidazole (PubChem CID 59359270) has the molecular formula C57H39IrN5O-2 and a molecular weight of 1002.19 g/mol. Its IUPAC name is 6-(8-carbazol-9-yldibenzofuran-2-yl)-11H-pyrazolo[1,5-f]phenanthridin-11-ide;iridium;2-phenyl-1-(2,4,6-trimethylphenyl)imidazole.
| Compound Name | 6-(8-carbazol-9-yldibenzofuran-2-yl)-11H-pyrazolo[1,5-f]phenanthridin-11-ide;iridium;2-phenyl-1-(2,4,6-trimethylphenyl)imidazole |
|---|---|
| PubChem CID | 59359270 |
| Molecular Formula | C57H39IrN5O-2 |
| Molecular Weight | 1002.19 g/mol |
| Exact Mass | 1002.28 |
| IUPAC Name | 6-(8-carbazol-9-yldibenzofuran-2-yl)-11H-pyrazolo[1,5-f]phenanthridin-11-ide;iridium;2-phenyl-1-(2,4,6-trimethylphenyl)imidazole |
| SMILES | Cc1cc(C)c(-n2ccnc2-c2[c-]cccc2)c(C)c1.[Ir].[c-]1cccc2c3cc(-c4ccc5oc6ccc(-n7c8ccccc8c8ccccc87)cc6c5c4)ccc3c3ccnn3c12 |
| InChI | InChI=1S/C39H22N3O.C18H17N2.Ir/c1-4-10-34-27(7-1)28-8-2-5-11-35(28)41(34)26-15-18-39-33(23-26)32-22-25(14-17-38(32)43-39)24-13-16-30-31(21-24)29-9-3-6-12-36(29)42-37(30)19-20-40-42;1-13-11-14(2)17(15(3)12-13)20-10-9-19-18(20)16-7-5-4-6-8-16;/h1-11,13-23H;4-7,9-12H,1-3H3;/q2*-1; |
| InChIKey | IDIFXKDKBIEIMT-UHFFFAOYSA-N |
| XLogP | 14.37 |
| TPSA | 53.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1002.19 |
| LogP ≤ 5 | 14.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|