About CID 59359282
CID 59359282 (PubChem CID 59359282) has the molecular formula C68H47N5O2PtS
and a molecular weight of 1193.30 g/mol.
Molecular Properties
| Compound Name | CID 59359282 |
| PubChem CID | 59359282 |
| Molecular Formula | C68H47N5O2PtS |
| Molecular Weight | 1193.30 g/mol |
| Exact Mass | 1192.31 |
| IUPAC Name | — |
| SMILES | COc1c(-c2ccccc2)cc(C)cc1-c1ccc(-c2c(C)nn(-c3[c-]cccc3)c2C)cc1.[Pt+2].[c-]1csc2c3cc(-c4ccc5oc6ccc(-n7c8ccccc8c8ccccc87)cc6c5c4)ccc3c3ccnn3c12 |
| InChI | InChI=1S/C37H20N3OS.C31H27N2O.Pt/c1-3-7-31-25(5-1)26-6-2-4-8-32(26)39(31)24-11-14-36-29(21-24)28-19-23(10-13-35(28)41-36)22-9-12-27-30(20-22)37-34(16-18-42-37)40-33(27)15-17-38-40;1-21-19-28(24-11-7-5-8-12-24)31(34-4)29(20-21)25-15-17-26(18-16-25)30-22(2)32-33(23(30)3)27-13-9-6-10-14-27;/h1-15,17-21H;5-13,15-20H,1-4H3;/q2*-1;+2 |
| InChIKey | SRNBFPAERONSRA-UHFFFAOYSA-N |
| XLogP | 17.77 |
| TPSA | 62.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 77 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1193.30 |
| LogP ≤ 5 | 17.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 59359282 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59359282?
The IUPAC name of CID 59359282 (CID 59359282) is not available.
What is the SMILES notation for CID 59359282?
The canonical SMILES for CID 59359282 is COc1c(-c2ccccc2)cc(C)cc1-c1ccc(-c2c(C)nn(-c3[c-]cccc3)c2C)cc1.[Pt+2].[c-]1csc2c3cc(-c4ccc5oc6ccc(-n7c8ccccc8c8ccccc87)cc6c5c4)ccc3c3ccnn3c12.
What is the InChIKey of CID 59359282?
The InChIKey is SRNBFPAERONSRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H20N3OS.C31H27N2O.Pt/c1-3-7-31-25(5-1)26-6-2-4-8-32(26)39(31)24-11-14-36-29(21-24)28-19-23(10-13-35(28)41-36)22-9-12-27-30(20-22)37-34(16-18-42-37)40-33(27)15-17-38-40;1-21-19-28(24-11-7-5-8-12-24)31(34-4)29(20-21)25-15-17-26(18-16-25)30-22(2)32-33(23(30)3)27-13-9-6-10-14-27;/h1-15,17-21H;5-13,15-20H,1-4H3;/q2*-1;+2.
What are the key properties of CID 59359282?
CID 59359282 has a molecular weight of 1193.30 g/mol, XLogP of 17.77, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59359282 is sourced from PubChem (CID 59359282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).