C72H47N5O2PtS — CID 59359312
CID 59359312 (PubChem CID 59359312) has the molecular formula C72H47N5O2PtS and a molecular weight of 1241.35 g/mol.
| Compound Name | CID 59359312 |
|---|---|
| PubChem CID | 59359312 |
| Molecular Formula | C72H47N5O2PtS |
| Molecular Weight | 1241.35 g/mol |
| Exact Mass | 1240.31 |
| IUPAC Name | — |
| SMILES | COc1c(-c2ccccc2)cc(C)cc1-c1ccc(-c2cnn(-c3[c-]cccc3)c2)cc1.[Pt+2].[c-]1csc2c1c1nccn1c1ccc(-c3cccc(-n4c5ccccc5c5cc(-c6ccc7oc8ccccc8c7c6)ccc54)c3)cc21 |
| InChI | InChI=1S/C43H24N3OS.C29H23N2O.Pt/c1-3-10-38-31(8-1)34-23-27(29-14-17-41-35(24-29)32-9-2-4-11-40(32)47-41)13-16-39(34)46(38)30-7-5-6-26(22-30)28-12-15-37-36(25-28)42-33(18-21-48-42)43-44-19-20-45(37)43;1-21-17-27(23-9-5-3-6-10-23)29(32-2)28(18-21)24-15-13-22(14-16-24)25-19-30-31(20-25)26-11-7-4-8-12-26;/h1-17,19-25H;3-11,13-20H,1-2H3;/q2*-1;+2 |
| InChIKey | REJIMOOVKSOMTK-UHFFFAOYSA-N |
| XLogP | 18.82 |
| TPSA | 62.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1241.35 |
| LogP ≤ 5 | 18.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|