About CID 59359459
CID 59359459 (PubChem CID 59359459) has the molecular formula C33H24IrN5O2S-
and a molecular weight of 746.87 g/mol.
Molecular Properties
| Compound Name | CID 59359459 |
| PubChem CID | 59359459 |
| Molecular Formula | C33H24IrN5O2S- |
| Molecular Weight | 746.87 g/mol |
| Exact Mass | 747.13 |
| IUPAC Name | — |
| SMILES | CC(=O)/C=C(/C)O.[Ir].[c-]1csc2c3c(ncn3-c3cccc(-n4c5ccccc5c5ccccc54)c3)c3ccnn3c12 |
| InChI | InChI=1S/C28H16N5S.C5H8O2.Ir/c1-3-10-22-20(8-1)21-9-2-4-11-23(21)32(22)19-7-5-6-18(16-19)31-17-29-26-24-12-14-30-33(24)25-13-15-34-28(25)27(26)31;1-4(6)3-5(2)7;/h1-12,14-17H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | ORDFFOAPPBYQGZ-LWFKIUJUSA-N |
| XLogP | 7.82 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 746.87 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 59359459 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59359459?
The IUPAC name of CID 59359459 (CID 59359459) is not available.
What is the SMILES notation for CID 59359459?
The canonical SMILES for CID 59359459 is CC(=O)/C=C(/C)O.[Ir].[c-]1csc2c3c(ncn3-c3cccc(-n4c5ccccc5c5ccccc54)c3)c3ccnn3c12.
What is the InChIKey of CID 59359459?
The InChIKey is ORDFFOAPPBYQGZ-LWFKIUJUSA-N. The full InChI is InChI=1S/C28H16N5S.C5H8O2.Ir/c1-3-10-22-20(8-1)21-9-2-4-11-23(21)32(22)19-7-5-6-18(16-19)31-17-29-26-24-12-14-30-33(24)25-13-15-34-28(25)27(26)31;1-4(6)3-5(2)7;/h1-12,14-17H;3,6H,1-2H3;/q-1;;/b;4-3-;.
What are the key properties of CID 59359459?
CID 59359459 has a molecular weight of 746.87 g/mol, XLogP of 7.82, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59359459 is sourced from PubChem (CID 59359459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).