C20H26N6O2 — CID 59359834
4-amino-2-butoxy-8-(1,2,3,4-tetrahydroisoquinolin-6-ylmethyl)-5,7-dihydropteridin-6-one (PubChem CID 59359834) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 4-amino-2-butoxy-8-(1,2,3,4-tetrahydroisoquinolin-6-ylmethyl)-5,7-dihydropteridin-6-one.
| Compound Name | 4-amino-2-butoxy-8-(1,2,3,4-tetrahydroisoquinolin-6-ylmethyl)-5,7-dihydropteridin-6-one |
|---|---|
| PubChem CID | 59359834 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 4-amino-2-butoxy-8-(1,2,3,4-tetrahydroisoquinolin-6-ylmethyl)-5,7-dihydropteridin-6-one |
| SMILES | CCCCOc1nc(N)c2c(n1)N(Cc1ccc3c(c1)CCNC3)CC(=O)N2 |
| InChI | InChI=1S/C20H26N6O2/c1-2-3-8-28-20-24-18(21)17-19(25-20)26(12-16(27)23-17)11-13-4-5-15-10-22-7-6-14(15)9-13/h4-5,9,22H,2-3,6-8,10-12H2,1H3,(H,23,27)(H2,21,24,25) |
| InChIKey | GIAWAFWWDZAVKI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|