C22H30N6O3 — CID 59359873
4-amino-2-butoxy-7-hydroxy-8-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5,7-dihydropteridin-6-one (PubChem CID 59359873) has the molecular formula C22H30N6O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is 4-amino-2-butoxy-7-hydroxy-8-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5,7-dihydropteridin-6-one.
| Compound Name | 4-amino-2-butoxy-7-hydroxy-8-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5,7-dihydropteridin-6-one |
|---|---|
| PubChem CID | 59359873 |
| Molecular Formula | C22H30N6O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 4-amino-2-butoxy-7-hydroxy-8-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5,7-dihydropteridin-6-one |
| SMILES | CCCCOc1nc(N)c2c(n1)N(Cc1cccc(CN3CCCC3)c1)C(O)C(=O)N2 |
| InChI | InChI=1S/C22H30N6O3/c1-2-3-11-31-22-25-18(23)17-19(26-22)28(21(30)20(29)24-17)14-16-8-6-7-15(12-16)13-27-9-4-5-10-27/h6-8,12,21,30H,2-5,9-11,13-14H2,1H3,(H,24,29)(H2,23,25,26) |
| InChIKey | AYYFXAQWWKSGRZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|