C33H38N2 — CID 59360004
4-tert-butyl-5,9,10,14,15,19,20-heptamethyl-21,23-diazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene (PubChem CID 59360004) has the molecular formula C33H38N2 and a molecular weight of 462.68 g/mol. Its IUPAC name is 4-tert-butyl-5,9,10,14,15,19,20-heptamethyl-21,23-diazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene.
| Compound Name | 4-tert-butyl-5,9,10,14,15,19,20-heptamethyl-21,23-diazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene |
|---|---|
| PubChem CID | 59360004 |
| Molecular Formula | C33H38N2 |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | 4-tert-butyl-5,9,10,14,15,19,20-heptamethyl-21,23-diazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene |
| SMILES | CC1=C2/C=C3\N=C(/C=C4\C/C(=C\C5=N/C(=C\C(=C1C(C)(C)C)C2)C(C)=C5C)C(C)=C4C)C(C)=C3C |
| InChI | InChI=1S/C33H38N2/c1-17-18(2)25-11-24(17)13-28-19(3)20(4)30(34-28)15-26-12-27(32(23(26)7)33(8,9)10)16-31-22(6)21(5)29(14-25)35-31/h13-16H,11-12H2,1-10H3/b24-13+,25-14+,26-15+,27-16+,28-13-,29-14-,30-15-,31-16- |
| InChIKey | OHIXAVPNSUJVGI-BWKNUDMLSA-N |
| XLogP | 9.01 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |