About [5-(2,4-difluorophenyl)-5-propyloxolan-3-yl] benzenesulfonate
[5-(2,4-difluorophenyl)-5-propyloxolan-3-yl] benzenesulfonate (PubChem CID 59360115) has the molecular formula C19H20F2O4S
and a molecular weight of 382.43 g/mol. Its IUPAC name is [5-(2,4-difluorophenyl)-5-propyloxolan-3-yl] benzenesulfonate.
Molecular Properties
| Compound Name | [5-(2,4-difluorophenyl)-5-propyloxolan-3-yl] benzenesulfonate |
| PubChem CID | 59360115 |
| Molecular Formula | C19H20F2O4S |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | [5-(2,4-difluorophenyl)-5-propyloxolan-3-yl] benzenesulfonate |
| SMILES | CCCC1(c2ccc(F)cc2F)CC(OS(=O)(=O)c2ccccc2)CO1 |
| InChI | InChI=1S/C19H20F2O4S/c1-2-10-19(17-9-8-14(20)11-18(17)21)12-15(13-24-19)25-26(22,23)16-6-4-3-5-7-16/h3-9,11,15H,2,10,12-13H2,1H3 |
| InChIKey | BVAAFHINRXLPON-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [5-(2,4-difluorophenyl)-5-propyloxolan-3-yl] benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2,4-difluorophenyl)-5-propyloxolan-3-yl] benzenesulfonate?
The IUPAC name of [5-(2,4-difluorophenyl)-5-propyloxolan-3-yl] benzenesulfonate (CID 59360115) is [5-(2,4-difluorophenyl)-5-propyloxolan-3-yl] benzenesulfonate.
What is the SMILES notation for [5-(2,4-difluorophenyl)-5-propyloxolan-3-yl] benzenesulfonate?
The canonical SMILES for [5-(2,4-difluorophenyl)-5-propyloxolan-3-yl] benzenesulfonate is CCCC1(c2ccc(F)cc2F)CC(OS(=O)(=O)c2ccccc2)CO1.
What is the InChIKey of [5-(2,4-difluorophenyl)-5-propyloxolan-3-yl] benzenesulfonate?
The InChIKey is BVAAFHINRXLPON-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20F2O4S/c1-2-10-19(17-9-8-14(20)11-18(17)21)12-15(13-24-19)25-26(22,23)16-6-4-3-5-7-16/h3-9,11,15H,2,10,12-13H2,1H3.
What are the key properties of [5-(2,4-difluorophenyl)-5-propyloxolan-3-yl] benzenesulfonate?
[5-(2,4-difluorophenyl)-5-propyloxolan-3-yl] benzenesulfonate has a molecular weight of 382.43 g/mol, XLogP of 4.15, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2,4-difluorophenyl)-5-propyloxolan-3-yl] benzenesulfonate is sourced from PubChem (CID 59360115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).