About [2,2-difluoro-2-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylmethyl]sulfonylethyl] benzoate
[2,2-difluoro-2-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylmethyl]sulfonylethyl] benzoate (PubChem CID 59360510) has the molecular formula C32H26F2O6S
and a molecular weight of 576.62 g/mol. Its IUPAC name is [2,2-difluoro-2-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylmethyl]sulfonylethyl] benzoate.
Molecular Properties
| Compound Name | [2,2-difluoro-2-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylmethyl]sulfonylethyl] benzoate |
| PubChem CID | 59360510 |
| Molecular Formula | C32H26F2O6S |
| Molecular Weight | 576.62 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | [2,2-difluoro-2-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylmethyl]sulfonylethyl] benzoate |
| SMILES | C=C(C)C(=O)Oc1ccc(C(c2ccccc2)(c2ccccc2)S(=O)(=O)C(F)(F)COC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H26F2O6S/c1-23(2)29(35)40-28-20-18-27(19-21-28)32(25-14-8-4-9-15-25,26-16-10-5-11-17-26)41(37,38)31(33,34)22-39-30(36)24-12-6-3-7-13-24/h3-21H,1,22H2,2H3 |
| InChIKey | CXGYTHVONGMPAK-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 576.62 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze [2,2-difluoro-2-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylmethyl]sulfonylethyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-difluoro-2-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylmethyl]sulfonylethyl] benzoate?
The IUPAC name of [2,2-difluoro-2-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylmethyl]sulfonylethyl] benzoate (CID 59360510) is [2,2-difluoro-2-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylmethyl]sulfonylethyl] benzoate.
What is the SMILES notation for [2,2-difluoro-2-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylmethyl]sulfonylethyl] benzoate?
The canonical SMILES for [2,2-difluoro-2-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylmethyl]sulfonylethyl] benzoate is C=C(C)C(=O)Oc1ccc(C(c2ccccc2)(c2ccccc2)S(=O)(=O)C(F)(F)COC(=O)c2ccccc2)cc1.
What is the InChIKey of [2,2-difluoro-2-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylmethyl]sulfonylethyl] benzoate?
The InChIKey is CXGYTHVONGMPAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H26F2O6S/c1-23(2)29(35)40-28-20-18-27(19-21-28)32(25-14-8-4-9-15-25,26-16-10-5-11-17-26)41(37,38)31(33,34)22-39-30(36)24-12-6-3-7-13-24/h3-21H,1,22H2,2H3.
What are the key properties of [2,2-difluoro-2-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylmethyl]sulfonylethyl] benzoate?
[2,2-difluoro-2-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylmethyl]sulfonylethyl] benzoate has a molecular weight of 576.62 g/mol, XLogP of 6.32, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-difluoro-2-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylmethyl]sulfonylethyl] benzoate is sourced from PubChem (CID 59360510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).