C33H32F2O6S — CID 59360512
[2,2-difluoro-2-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylmethyl]sulfonylethyl] bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 59360512) has the molecular formula C33H32F2O6S and a molecular weight of 594.68 g/mol. Its IUPAC name is [2,2-difluoro-2-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylmethyl]sulfonylethyl] bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | [2,2-difluoro-2-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylmethyl]sulfonylethyl] bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 59360512 |
| Molecular Formula | C33H32F2O6S |
| Molecular Weight | 594.68 g/mol |
| Exact Mass | 594.19 |
| IUPAC Name | [2,2-difluoro-2-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylmethyl]sulfonylethyl] bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | C=C(C)C(=O)Oc1ccc(C(c2ccccc2)(c2ccccc2)S(=O)(=O)C(F)(F)COC(=O)C2CC3CCC2C3)cc1 |
| InChI | InChI=1S/C33H32F2O6S/c1-22(2)30(36)41-28-17-15-27(16-18-28)33(25-9-5-3-6-10-25,26-11-7-4-8-12-26)42(38,39)32(34,35)21-40-31(37)29-20-23-13-14-24(29)19-23/h3-12,15-18,23-24,29H,1,13-14,19-21H2,2H3 |
| InChIKey | FIVFNCBXYWJELY-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.68 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|