About [4-[(1,1-difluoro-2-propanoyloxyethyl)sulfonyl-diphenylmethyl]phenyl] 2-methylprop-2-enoate
[4-[(1,1-difluoro-2-propanoyloxyethyl)sulfonyl-diphenylmethyl]phenyl] 2-methylprop-2-enoate (PubChem CID 59360528) has the molecular formula C28H26F2O6S
and a molecular weight of 528.57 g/mol. Its IUPAC name is [4-[(1,1-difluoro-2-propanoyloxyethyl)sulfonyl-diphenylmethyl]phenyl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [4-[(1,1-difluoro-2-propanoyloxyethyl)sulfonyl-diphenylmethyl]phenyl] 2-methylprop-2-enoate |
| PubChem CID | 59360528 |
| Molecular Formula | C28H26F2O6S |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | [4-[(1,1-difluoro-2-propanoyloxyethyl)sulfonyl-diphenylmethyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(C(c2ccccc2)(c2ccccc2)S(=O)(=O)C(F)(F)COC(=O)CC)cc1 |
| InChI | InChI=1S/C28H26F2O6S/c1-4-25(31)35-19-27(29,30)37(33,34)28(21-11-7-5-8-12-21,22-13-9-6-10-14-22)23-15-17-24(18-16-23)36-26(32)20(2)3/h5-18H,2,4,19H2,1,3H3 |
| InChIKey | PAFDWTPYEDOUHH-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze [4-[(1,1-difluoro-2-propanoyloxyethyl)sulfonyl-diphenylmethyl]phenyl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(1,1-difluoro-2-propanoyloxyethyl)sulfonyl-diphenylmethyl]phenyl] 2-methylprop-2-enoate?
The IUPAC name of [4-[(1,1-difluoro-2-propanoyloxyethyl)sulfonyl-diphenylmethyl]phenyl] 2-methylprop-2-enoate (CID 59360528) is [4-[(1,1-difluoro-2-propanoyloxyethyl)sulfonyl-diphenylmethyl]phenyl] 2-methylprop-2-enoate.
What is the SMILES notation for [4-[(1,1-difluoro-2-propanoyloxyethyl)sulfonyl-diphenylmethyl]phenyl] 2-methylprop-2-enoate?
The canonical SMILES for [4-[(1,1-difluoro-2-propanoyloxyethyl)sulfonyl-diphenylmethyl]phenyl] 2-methylprop-2-enoate is C=C(C)C(=O)Oc1ccc(C(c2ccccc2)(c2ccccc2)S(=O)(=O)C(F)(F)COC(=O)CC)cc1.
What is the InChIKey of [4-[(1,1-difluoro-2-propanoyloxyethyl)sulfonyl-diphenylmethyl]phenyl] 2-methylprop-2-enoate?
The InChIKey is PAFDWTPYEDOUHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26F2O6S/c1-4-25(31)35-19-27(29,30)37(33,34)28(21-11-7-5-8-12-21,22-13-9-6-10-14-22)23-15-17-24(18-16-23)36-26(32)20(2)3/h5-18H,2,4,19H2,1,3H3.
What are the key properties of [4-[(1,1-difluoro-2-propanoyloxyethyl)sulfonyl-diphenylmethyl]phenyl] 2-methylprop-2-enoate?
[4-[(1,1-difluoro-2-propanoyloxyethyl)sulfonyl-diphenylmethyl]phenyl] 2-methylprop-2-enoate has a molecular weight of 528.57 g/mol, XLogP of 5.42, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(1,1-difluoro-2-propanoyloxyethyl)sulfonyl-diphenylmethyl]phenyl] 2-methylprop-2-enoate is sourced from PubChem (CID 59360528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).