C32H32F2O6S — CID 59360533
[2,2-difluoro-2-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylmethyl]sulfonylethyl] cyclohexanecarboxylate (PubChem CID 59360533) has the molecular formula C32H32F2O6S and a molecular weight of 582.67 g/mol. Its IUPAC name is [2,2-difluoro-2-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylmethyl]sulfonylethyl] cyclohexanecarboxylate.
| Compound Name | [2,2-difluoro-2-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylmethyl]sulfonylethyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 59360533 |
| Molecular Formula | C32H32F2O6S |
| Molecular Weight | 582.67 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | [2,2-difluoro-2-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylmethyl]sulfonylethyl] cyclohexanecarboxylate |
| SMILES | C=C(C)C(=O)Oc1ccc(C(c2ccccc2)(c2ccccc2)S(=O)(=O)C(F)(F)COC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C32H32F2O6S/c1-23(2)29(35)40-28-20-18-27(19-21-28)32(25-14-8-4-9-15-25,26-16-10-5-11-17-26)41(37,38)31(33,34)22-39-30(36)24-12-6-3-7-13-24/h4-5,8-11,14-21,24H,1,3,6-7,12-13,22H2,2H3 |
| InChIKey | NHELJYUTPPVDHL-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.67 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|