About [4,5-diacetyloxy-6-[4-(naphthalen-2-ylmethoxymethyl)triazol-1-yl]oxan-3-yl] acetate
[4,5-diacetyloxy-6-[4-(naphthalen-2-ylmethoxymethyl)triazol-1-yl]oxan-3-yl] acetate (PubChem CID 59360683) has the molecular formula C25H27N3O8
and a molecular weight of 497.50 g/mol. Its IUPAC name is [4,5-diacetyloxy-6-[4-(naphthalen-2-ylmethoxymethyl)triazol-1-yl]oxan-3-yl] acetate.
Molecular Properties
| Compound Name | [4,5-diacetyloxy-6-[4-(naphthalen-2-ylmethoxymethyl)triazol-1-yl]oxan-3-yl] acetate |
| PubChem CID | 59360683 |
| Molecular Formula | C25H27N3O8 |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | [4,5-diacetyloxy-6-[4-(naphthalen-2-ylmethoxymethyl)triazol-1-yl]oxan-3-yl] acetate |
| SMILES | CC(=O)OC1COC(n2cc(COCc3ccc4ccccc4c3)nn2)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C25H27N3O8/c1-15(29)34-22-14-33-25(24(36-17(3)31)23(22)35-16(2)30)28-11-21(26-27-28)13-32-12-18-8-9-19-6-4-5-7-20(19)10-18/h4-11,22-25H,12-14H2,1-3H3 |
| InChIKey | AOMXJTVYOAKWBV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 128.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [4,5-diacetyloxy-6-[4-(naphthalen-2-ylmethoxymethyl)triazol-1-yl]oxan-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,5-diacetyloxy-6-[4-(naphthalen-2-ylmethoxymethyl)triazol-1-yl]oxan-3-yl] acetate?
The IUPAC name of [4,5-diacetyloxy-6-[4-(naphthalen-2-ylmethoxymethyl)triazol-1-yl]oxan-3-yl] acetate (CID 59360683) is [4,5-diacetyloxy-6-[4-(naphthalen-2-ylmethoxymethyl)triazol-1-yl]oxan-3-yl] acetate.
What is the SMILES notation for [4,5-diacetyloxy-6-[4-(naphthalen-2-ylmethoxymethyl)triazol-1-yl]oxan-3-yl] acetate?
The canonical SMILES for [4,5-diacetyloxy-6-[4-(naphthalen-2-ylmethoxymethyl)triazol-1-yl]oxan-3-yl] acetate is CC(=O)OC1COC(n2cc(COCc3ccc4ccccc4c3)nn2)C(OC(C)=O)C1OC(C)=O.
What is the InChIKey of [4,5-diacetyloxy-6-[4-(naphthalen-2-ylmethoxymethyl)triazol-1-yl]oxan-3-yl] acetate?
The InChIKey is AOMXJTVYOAKWBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27N3O8/c1-15(29)34-22-14-33-25(24(36-17(3)31)23(22)35-16(2)30)28-11-21(26-27-28)13-32-12-18-8-9-19-6-4-5-7-20(19)10-18/h4-11,22-25H,12-14H2,1-3H3.
What are the key properties of [4,5-diacetyloxy-6-[4-(naphthalen-2-ylmethoxymethyl)triazol-1-yl]oxan-3-yl] acetate?
[4,5-diacetyloxy-6-[4-(naphthalen-2-ylmethoxymethyl)triazol-1-yl]oxan-3-yl] acetate has a molecular weight of 497.50 g/mol, XLogP of 2.47, 8 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for [4,5-diacetyloxy-6-[4-(naphthalen-2-ylmethoxymethyl)triazol-1-yl]oxan-3-yl] acetate is sourced from PubChem (CID 59360683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).