About 1-chloro-N,N-dimethyl-1-pyrrolidin-1-ylmethanamine
1-chloro-N,N-dimethyl-1-pyrrolidin-1-ylmethanamine (PubChem CID 59360872) has the molecular formula C7H15ClN2
and a molecular weight of 162.66 g/mol. Its IUPAC name is 1-chloro-N,N-dimethyl-1-pyrrolidin-1-ylmethanamine.
Molecular Properties
| Compound Name | 1-chloro-N,N-dimethyl-1-pyrrolidin-1-ylmethanamine |
| PubChem CID | 59360872 |
| Molecular Formula | C7H15ClN2 |
| Molecular Weight | 162.66 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 1-chloro-N,N-dimethyl-1-pyrrolidin-1-ylmethanamine |
| SMILES | CN(C)C(Cl)N1CCCC1 |
| InChI | InChI=1S/C7H15ClN2/c1-9(2)7(8)10-5-3-4-6-10/h7H,3-6H2,1-2H3 |
| InChIKey | YCWQSOSKZMYQQP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.66 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-N,N-dimethyl-1-pyrrolidin-1-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-N,N-dimethyl-1-pyrrolidin-1-ylmethanamine?
The IUPAC name of 1-chloro-N,N-dimethyl-1-pyrrolidin-1-ylmethanamine (CID 59360872) is 1-chloro-N,N-dimethyl-1-pyrrolidin-1-ylmethanamine.
What is the SMILES notation for 1-chloro-N,N-dimethyl-1-pyrrolidin-1-ylmethanamine?
The canonical SMILES for 1-chloro-N,N-dimethyl-1-pyrrolidin-1-ylmethanamine is CN(C)C(Cl)N1CCCC1.
What is the InChIKey of 1-chloro-N,N-dimethyl-1-pyrrolidin-1-ylmethanamine?
The InChIKey is YCWQSOSKZMYQQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15ClN2/c1-9(2)7(8)10-5-3-4-6-10/h7H,3-6H2,1-2H3.
What are the key properties of 1-chloro-N,N-dimethyl-1-pyrrolidin-1-ylmethanamine?
1-chloro-N,N-dimethyl-1-pyrrolidin-1-ylmethanamine has a molecular weight of 162.66 g/mol, XLogP of 1.17, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-N,N-dimethyl-1-pyrrolidin-1-ylmethanamine is sourced from PubChem (CID 59360872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).