C30H36N2O2 — CID 59361020
4-[2,2,3,3,5,5,6,6-octadeuterio-4-hydroxy-4-(4-methylphenyl)piperidin-1-yl]-2,2-bis(2,3,4,5,6-pentadeuteriophenyl)-N,N-bis(trideuteriomethyl)butanamide (PubChem CID 59361020) has the molecular formula C30H36N2O2 and a molecular weight of 480.78 g/mol. Its IUPAC name is 4-[2,2,3,3,5,5,6,6-octadeuterio-4-hydroxy-4-(4-methylphenyl)piperidin-1-yl]-2,2-bis(2,3,4,5,6-pentadeuteriophenyl)-N,N-bis(trideuteriomethyl)butanamide.
| Compound Name | 4-[2,2,3,3,5,5,6,6-octadeuterio-4-hydroxy-4-(4-methylphenyl)piperidin-1-yl]-2,2-bis(2,3,4,5,6-pentadeuteriophenyl)-N,N-bis(trideuteriomethyl)butanamide |
|---|---|
| PubChem CID | 59361020 |
| Molecular Formula | C30H36N2O2 |
| Molecular Weight | 480.78 g/mol |
| Exact Mass | 480.43 |
| IUPAC Name | 4-[2,2,3,3,5,5,6,6-octadeuterio-4-hydroxy-4-(4-methylphenyl)piperidin-1-yl]-2,2-bis(2,3,4,5,6-pentadeuteriophenyl)-N,N-bis(trideuteriomethyl)butanamide |
| SMILES | [2H]c1c([2H])c([2H])c(C(CCN2C([2H])([2H])C([2H])([2H])C(O)(c3ccc(C)cc3)C([2H])([2H])C2([2H])[2H])(C(=O)N(C([2H])([2H])[2H])C([2H])([2H])[2H])c2c([2H])c([2H])c([2H])c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C30H36N2O2/c1-24-14-16-25(17-15-24)29(34)18-21-32(22-19-29)23-20-30(28(33)31(2)3,26-10-6-4-7-11-26)27-12-8-5-9-13-27/h4-17,34H,18-23H2,1-3H3/i2D3,3D3,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,18D2,19D2,21D2,22D2 |
| InChIKey | MUKGYYFUUFOKCM-CZIZHCSCSA-N |
| XLogP | 4.74 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.78 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |