About 5-[(1R,5R)-3,6-diazabicyclo[3.2.1]octane-3-carbonyl]furan-3-carbonitrile
5-[(1R,5R)-3,6-diazabicyclo[3.2.1]octane-3-carbonyl]furan-3-carbonitrile (PubChem CID 59361674) has the molecular formula C12H13N3O2
and a molecular weight of 231.25 g/mol. Its IUPAC name is 5-[(1R,5R)-3,6-diazabicyclo[3.2.1]octane-3-carbonyl]furan-3-carbonitrile.
Molecular Properties
| Compound Name | 5-[(1R,5R)-3,6-diazabicyclo[3.2.1]octane-3-carbonyl]furan-3-carbonitrile |
| PubChem CID | 59361674 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 5-[(1R,5R)-3,6-diazabicyclo[3.2.1]octane-3-carbonyl]furan-3-carbonitrile |
| SMILES | N#Cc1coc(C(=O)N2C[C@H]3CN[C@H](C3)C2)c1 |
| InChI | InChI=1S/C12H13N3O2/c13-3-8-2-11(17-7-8)12(16)15-5-9-1-10(6-15)14-4-9/h2,7,9-10,14H,1,4-6H2/t9-,10-/m1/s1 |
| InChIKey | WPFMJZKCKXJHAK-NXEZZACHSA-N |
| XLogP | 0.59 |
| TPSA | 69.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(1R,5R)-3,6-diazabicyclo[3.2.1]octane-3-carbonyl]furan-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1R,5R)-3,6-diazabicyclo[3.2.1]octane-3-carbonyl]furan-3-carbonitrile?
The IUPAC name of 5-[(1R,5R)-3,6-diazabicyclo[3.2.1]octane-3-carbonyl]furan-3-carbonitrile (CID 59361674) is 5-[(1R,5R)-3,6-diazabicyclo[3.2.1]octane-3-carbonyl]furan-3-carbonitrile.
What is the SMILES notation for 5-[(1R,5R)-3,6-diazabicyclo[3.2.1]octane-3-carbonyl]furan-3-carbonitrile?
The canonical SMILES for 5-[(1R,5R)-3,6-diazabicyclo[3.2.1]octane-3-carbonyl]furan-3-carbonitrile is N#Cc1coc(C(=O)N2C[C@H]3CN[C@H](C3)C2)c1.
What is the InChIKey of 5-[(1R,5R)-3,6-diazabicyclo[3.2.1]octane-3-carbonyl]furan-3-carbonitrile?
The InChIKey is WPFMJZKCKXJHAK-NXEZZACHSA-N. The full InChI is InChI=1S/C12H13N3O2/c13-3-8-2-11(17-7-8)12(16)15-5-9-1-10(6-15)14-4-9/h2,7,9-10,14H,1,4-6H2/t9-,10-/m1/s1.
What are the key properties of 5-[(1R,5R)-3,6-diazabicyclo[3.2.1]octane-3-carbonyl]furan-3-carbonitrile?
5-[(1R,5R)-3,6-diazabicyclo[3.2.1]octane-3-carbonyl]furan-3-carbonitrile has a molecular weight of 231.25 g/mol, XLogP of 0.59, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1R,5R)-3,6-diazabicyclo[3.2.1]octane-3-carbonyl]furan-3-carbonitrile is sourced from PubChem (CID 59361674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).