About (4-bromofuran-2-yl)-[(1R,5R)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone
(4-bromofuran-2-yl)-[(1R,5R)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone (PubChem CID 59361697) has the molecular formula C11H13BrN2O2
and a molecular weight of 285.14 g/mol. Its IUPAC name is (4-bromofuran-2-yl)-[(1R,5R)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone.
Molecular Properties
| Compound Name | (4-bromofuran-2-yl)-[(1R,5R)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone |
| PubChem CID | 59361697 |
| Molecular Formula | C11H13BrN2O2 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | (4-bromofuran-2-yl)-[(1R,5R)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone |
| SMILES | O=C(c1cc(Br)co1)N1C[C@H]2CN[C@H](C2)C1 |
| InChI | InChI=1S/C11H13BrN2O2/c12-8-2-10(16-6-8)11(15)14-4-7-1-9(5-14)13-3-7/h2,6-7,9,13H,1,3-5H2/t7-,9-/m1/s1 |
| InChIKey | GRUQTNBOCPUHGK-VXNVDRBHSA-N |
| XLogP | 1.48 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-bromofuran-2-yl)-[(1R,5R)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromofuran-2-yl)-[(1R,5R)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone?
The IUPAC name of (4-bromofuran-2-yl)-[(1R,5R)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone (CID 59361697) is (4-bromofuran-2-yl)-[(1R,5R)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone.
What is the SMILES notation for (4-bromofuran-2-yl)-[(1R,5R)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone?
The canonical SMILES for (4-bromofuran-2-yl)-[(1R,5R)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone is O=C(c1cc(Br)co1)N1C[C@H]2CN[C@H](C2)C1.
What is the InChIKey of (4-bromofuran-2-yl)-[(1R,5R)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone?
The InChIKey is GRUQTNBOCPUHGK-VXNVDRBHSA-N. The full InChI is InChI=1S/C11H13BrN2O2/c12-8-2-10(16-6-8)11(15)14-4-7-1-9(5-14)13-3-7/h2,6-7,9,13H,1,3-5H2/t7-,9-/m1/s1.
What are the key properties of (4-bromofuran-2-yl)-[(1R,5R)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone?
(4-bromofuran-2-yl)-[(1R,5R)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone has a molecular weight of 285.14 g/mol, XLogP of 1.48, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromofuran-2-yl)-[(1R,5R)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone is sourced from PubChem (CID 59361697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).