About [3-[[[1-[(3,4-difluorophenyl)methyl]-2-oxopyridine-3-carbonyl]amino]methyl]phenyl]boronic acid
[3-[[[1-[(3,4-difluorophenyl)methyl]-2-oxopyridine-3-carbonyl]amino]methyl]phenyl]boronic acid (PubChem CID 59362353) has the molecular formula C20H17BF2N2O4
and a molecular weight of 398.17 g/mol. Its IUPAC name is [3-[[[1-[(3,4-difluorophenyl)methyl]-2-oxopyridine-3-carbonyl]amino]methyl]phenyl]boronic acid.
Molecular Properties
| Compound Name | [3-[[[1-[(3,4-difluorophenyl)methyl]-2-oxopyridine-3-carbonyl]amino]methyl]phenyl]boronic acid |
| PubChem CID | 59362353 |
| Molecular Formula | C20H17BF2N2O4 |
| Molecular Weight | 398.17 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | [3-[[[1-[(3,4-difluorophenyl)methyl]-2-oxopyridine-3-carbonyl]amino]methyl]phenyl]boronic acid |
| SMILES | O=C(NCc1cccc(B(O)O)c1)c1cccn(Cc2ccc(F)c(F)c2)c1=O |
| InChI | InChI=1S/C20H17BF2N2O4/c22-17-7-6-14(10-18(17)23)12-25-8-2-5-16(20(25)27)19(26)24-11-13-3-1-4-15(9-13)21(28)29/h1-10,28-29H,11-12H2,(H,24,26) |
| InChIKey | ZWFNXPCAXBPLAT-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.17 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [3-[[[1-[(3,4-difluorophenyl)methyl]-2-oxopyridine-3-carbonyl]amino]methyl]phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[[1-[(3,4-difluorophenyl)methyl]-2-oxopyridine-3-carbonyl]amino]methyl]phenyl]boronic acid?
The IUPAC name of [3-[[[1-[(3,4-difluorophenyl)methyl]-2-oxopyridine-3-carbonyl]amino]methyl]phenyl]boronic acid (CID 59362353) is [3-[[[1-[(3,4-difluorophenyl)methyl]-2-oxopyridine-3-carbonyl]amino]methyl]phenyl]boronic acid.
What is the SMILES notation for [3-[[[1-[(3,4-difluorophenyl)methyl]-2-oxopyridine-3-carbonyl]amino]methyl]phenyl]boronic acid?
The canonical SMILES for [3-[[[1-[(3,4-difluorophenyl)methyl]-2-oxopyridine-3-carbonyl]amino]methyl]phenyl]boronic acid is O=C(NCc1cccc(B(O)O)c1)c1cccn(Cc2ccc(F)c(F)c2)c1=O.
What is the InChIKey of [3-[[[1-[(3,4-difluorophenyl)methyl]-2-oxopyridine-3-carbonyl]amino]methyl]phenyl]boronic acid?
The InChIKey is ZWFNXPCAXBPLAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17BF2N2O4/c22-17-7-6-14(10-18(17)23)12-25-8-2-5-16(20(25)27)19(26)24-11-13-3-1-4-15(9-13)21(28)29/h1-10,28-29H,11-12H2,(H,24,26).
What are the key properties of [3-[[[1-[(3,4-difluorophenyl)methyl]-2-oxopyridine-3-carbonyl]amino]methyl]phenyl]boronic acid?
[3-[[[1-[(3,4-difluorophenyl)methyl]-2-oxopyridine-3-carbonyl]amino]methyl]phenyl]boronic acid has a molecular weight of 398.17 g/mol, XLogP of 0.78, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[[1-[(3,4-difluorophenyl)methyl]-2-oxopyridine-3-carbonyl]amino]methyl]phenyl]boronic acid is sourced from PubChem (CID 59362353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).