C25H22F2N4O4 — CID 59362652
N-[2-[(1-cyclopropyl-2-oxo-3H-benzimidazol-5-yl)oxy]ethyl]-1-[(3,4-difluorophenyl)methyl]-2-oxopyridine-3-carboxamide (PubChem CID 59362652) has the molecular formula C25H22F2N4O4 and a molecular weight of 480.47 g/mol. Its IUPAC name is N-[2-[(1-cyclopropyl-2-oxo-3H-benzimidazol-5-yl)oxy]ethyl]-1-[(3,4-difluorophenyl)methyl]-2-oxopyridine-3-carboxamide.
| Compound Name | N-[2-[(1-cyclopropyl-2-oxo-3H-benzimidazol-5-yl)oxy]ethyl]-1-[(3,4-difluorophenyl)methyl]-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 59362652 |
| Molecular Formula | C25H22F2N4O4 |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | N-[2-[(1-cyclopropyl-2-oxo-3H-benzimidazol-5-yl)oxy]ethyl]-1-[(3,4-difluorophenyl)methyl]-2-oxopyridine-3-carboxamide |
| SMILES | O=C(NCCOc1ccc2c(c1)[nH]c(=O)n2C1CC1)c1cccn(Cc2ccc(F)c(F)c2)c1=O |
| InChI | InChI=1S/C25H22F2N4O4/c26-19-7-3-15(12-20(19)27)14-30-10-1-2-18(24(30)33)23(32)28-9-11-35-17-6-8-22-21(13-17)29-25(34)31(22)16-4-5-16/h1-3,6-8,10,12-13,16H,4-5,9,11,14H2,(H,28,32)(H,29,34) |
| InChIKey | XJEUXSVCLAQKNZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|