ethyl 2-(4,5-diphenyltriazol-2-yl)acetate

C18H17N3O2 — CID 59363121

IUPACethyl 2-(4,5-diphenyltriazol-2-yl)acetate
SMILESCCOC(=O)Cn1nc(-c2ccccc2)c(-c2ccccc2)n1
InChIInChI=1S/C18H17N3O2/c1-2-23-16(22)13-21-19-17(14-9-5-3-6-10-14)18(20-21)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3
InChIKeyDNSIHCROOVVQLU-UHFFFAOYSA-N
MW307.35 g/mol
LogP3.18
Rot. Bonds5

About ethyl 2-(4,5-diphenyltriazol-2-yl)acetate

ethyl 2-(4,5-diphenyltriazol-2-yl)acetate (PubChem CID 59363121) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is ethyl 2-(4,5-diphenyltriazol-2-yl)acetate.

Molecular Properties

Compound Nameethyl 2-(4,5-diphenyltriazol-2-yl)acetate
PubChem CID59363121
Molecular FormulaC18H17N3O2
Molecular Weight307.35 g/mol
Exact Mass307.13
IUPAC Nameethyl 2-(4,5-diphenyltriazol-2-yl)acetate
SMILESCCOC(=O)Cn1nc(-c2ccccc2)c(-c2ccccc2)n1
InChIInChI=1S/C18H17N3O2/c1-2-23-16(22)13-21-19-17(14-9-5-3-6-10-14)18(20-21)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3
InChIKeyDNSIHCROOVVQLU-UHFFFAOYSA-N
XLogP3.18
TPSA57.01 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.35
LogP ≤ 53.18
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze ethyl 2-(4,5-diphenyltriazol-2-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-(4,5-diphenyltriazol-2-yl)acetate?
The IUPAC name of ethyl 2-(4,5-diphenyltriazol-2-yl)acetate (CID 59363121) is ethyl 2-(4,5-diphenyltriazol-2-yl)acetate.
What is the SMILES notation for ethyl 2-(4,5-diphenyltriazol-2-yl)acetate?
The canonical SMILES for ethyl 2-(4,5-diphenyltriazol-2-yl)acetate is CCOC(=O)Cn1nc(-c2ccccc2)c(-c2ccccc2)n1.
What is the InChIKey of ethyl 2-(4,5-diphenyltriazol-2-yl)acetate?
The InChIKey is DNSIHCROOVVQLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O2/c1-2-23-16(22)13-21-19-17(14-9-5-3-6-10-14)18(20-21)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3.
What are the key properties of ethyl 2-(4,5-diphenyltriazol-2-yl)acetate?
ethyl 2-(4,5-diphenyltriazol-2-yl)acetate has a molecular weight of 307.35 g/mol, XLogP of 3.18, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4,5-diphenyltriazol-2-yl)acetate is sourced from PubChem (CID 59363121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).