About 1-[[2-[4,5-bis(4-chlorophenyl)triazol-1-yl]acetyl]amino]-3-hexylurea
1-[[2-[4,5-bis(4-chlorophenyl)triazol-1-yl]acetyl]amino]-3-hexylurea (PubChem CID 59363165) has the molecular formula C23H26Cl2N6O2
and a molecular weight of 489.41 g/mol. Its IUPAC name is 1-[[2-[4,5-bis(4-chlorophenyl)triazol-1-yl]acetyl]amino]-3-hexylurea.
Molecular Properties
| Compound Name | 1-[[2-[4,5-bis(4-chlorophenyl)triazol-1-yl]acetyl]amino]-3-hexylurea |
| PubChem CID | 59363165 |
| Molecular Formula | C23H26Cl2N6O2 |
| Molecular Weight | 489.41 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 1-[[2-[4,5-bis(4-chlorophenyl)triazol-1-yl]acetyl]amino]-3-hexylurea |
| SMILES | CCCCCCNC(=O)NNC(=O)Cn1nnc(-c2ccc(Cl)cc2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H26Cl2N6O2/c1-2-3-4-5-14-26-23(33)29-27-20(32)15-31-22(17-8-12-19(25)13-9-17)21(28-30-31)16-6-10-18(24)11-7-16/h6-13H,2-5,14-15H2,1H3,(H,27,32)(H2,26,29,33) |
| InChIKey | FKXZFLCCLPQHFL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 489.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[[2-[4,5-bis(4-chlorophenyl)triazol-1-yl]acetyl]amino]-3-hexylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-[4,5-bis(4-chlorophenyl)triazol-1-yl]acetyl]amino]-3-hexylurea?
The IUPAC name of 1-[[2-[4,5-bis(4-chlorophenyl)triazol-1-yl]acetyl]amino]-3-hexylurea (CID 59363165) is 1-[[2-[4,5-bis(4-chlorophenyl)triazol-1-yl]acetyl]amino]-3-hexylurea.
What is the SMILES notation for 1-[[2-[4,5-bis(4-chlorophenyl)triazol-1-yl]acetyl]amino]-3-hexylurea?
The canonical SMILES for 1-[[2-[4,5-bis(4-chlorophenyl)triazol-1-yl]acetyl]amino]-3-hexylurea is CCCCCCNC(=O)NNC(=O)Cn1nnc(-c2ccc(Cl)cc2)c1-c1ccc(Cl)cc1.
What is the InChIKey of 1-[[2-[4,5-bis(4-chlorophenyl)triazol-1-yl]acetyl]amino]-3-hexylurea?
The InChIKey is FKXZFLCCLPQHFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26Cl2N6O2/c1-2-3-4-5-14-26-23(33)29-27-20(32)15-31-22(17-8-12-19(25)13-9-17)21(28-30-31)16-6-10-18(24)11-7-16/h6-13H,2-5,14-15H2,1H3,(H,27,32)(H2,26,29,33).
What are the key properties of 1-[[2-[4,5-bis(4-chlorophenyl)triazol-1-yl]acetyl]amino]-3-hexylurea?
1-[[2-[4,5-bis(4-chlorophenyl)triazol-1-yl]acetyl]amino]-3-hexylurea has a molecular weight of 489.41 g/mol, XLogP of 4.83, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-[4,5-bis(4-chlorophenyl)triazol-1-yl]acetyl]amino]-3-hexylurea is sourced from PubChem (CID 59363165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).