About methyl 6-methyl-3-(1,3-thiazol-2-yl)pyridine-2-carboxylate
methyl 6-methyl-3-(1,3-thiazol-2-yl)pyridine-2-carboxylate (PubChem CID 59363657) has the molecular formula C11H10N2O2S
and a molecular weight of 234.28 g/mol. Its IUPAC name is methyl 6-methyl-3-(1,3-thiazol-2-yl)pyridine-2-carboxylate.
Analyze methyl 6-methyl-3-(1,3-thiazol-2-yl)pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-methyl-3-(1,3-thiazol-2-yl)pyridine-2-carboxylate?
The IUPAC name of methyl 6-methyl-3-(1,3-thiazol-2-yl)pyridine-2-carboxylate (CID 59363657) is methyl 6-methyl-3-(1,3-thiazol-2-yl)pyridine-2-carboxylate.
What is the SMILES notation for methyl 6-methyl-3-(1,3-thiazol-2-yl)pyridine-2-carboxylate?
The canonical SMILES for methyl 6-methyl-3-(1,3-thiazol-2-yl)pyridine-2-carboxylate is COC(=O)c1nc(C)ccc1-c1nccs1.
What is the InChIKey of methyl 6-methyl-3-(1,3-thiazol-2-yl)pyridine-2-carboxylate?
The InChIKey is APAXMZSTJJLUPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2S/c1-7-3-4-8(10-12-5-6-16-10)9(13-7)11(14)15-2/h3-6H,1-2H3.
What are the key properties of methyl 6-methyl-3-(1,3-thiazol-2-yl)pyridine-2-carboxylate?
methyl 6-methyl-3-(1,3-thiazol-2-yl)pyridine-2-carboxylate has a molecular weight of 234.28 g/mol, XLogP of 2.30, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-methyl-3-(1,3-thiazol-2-yl)pyridine-2-carboxylate is sourced from PubChem (CID 59363657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).