About 6-[[2-(2,4-difluorophenoxy)-2-(4-methylsulfonylphenyl)propanoyl]amino]pyridine-3-carboxylic acid
6-[[2-(2,4-difluorophenoxy)-2-(4-methylsulfonylphenyl)propanoyl]amino]pyridine-3-carboxylic acid (PubChem CID 59363818) has the molecular formula C22H18F2N2O6S
and a molecular weight of 476.46 g/mol. Its IUPAC name is 6-[[2-(2,4-difluorophenoxy)-2-(4-methylsulfonylphenyl)propanoyl]amino]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-[[2-(2,4-difluorophenoxy)-2-(4-methylsulfonylphenyl)propanoyl]amino]pyridine-3-carboxylic acid |
| PubChem CID | 59363818 |
| Molecular Formula | C22H18F2N2O6S |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 6-[[2-(2,4-difluorophenoxy)-2-(4-methylsulfonylphenyl)propanoyl]amino]pyridine-3-carboxylic acid |
| SMILES | CC(Oc1ccc(F)cc1F)(C(=O)Nc1ccc(C(=O)O)cn1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C22H18F2N2O6S/c1-22(32-18-9-6-15(23)11-17(18)24,14-4-7-16(8-5-14)33(2,30)31)21(29)26-19-10-3-13(12-25-19)20(27)28/h3-12H,1-2H3,(H,27,28)(H,25,26,29) |
| InChIKey | IXAXKBRQLYHOEN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 122.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[[2-(2,4-difluorophenoxy)-2-(4-methylsulfonylphenyl)propanoyl]amino]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[2-(2,4-difluorophenoxy)-2-(4-methylsulfonylphenyl)propanoyl]amino]pyridine-3-carboxylic acid?
The IUPAC name of 6-[[2-(2,4-difluorophenoxy)-2-(4-methylsulfonylphenyl)propanoyl]amino]pyridine-3-carboxylic acid (CID 59363818) is 6-[[2-(2,4-difluorophenoxy)-2-(4-methylsulfonylphenyl)propanoyl]amino]pyridine-3-carboxylic acid.
What is the SMILES notation for 6-[[2-(2,4-difluorophenoxy)-2-(4-methylsulfonylphenyl)propanoyl]amino]pyridine-3-carboxylic acid?
The canonical SMILES for 6-[[2-(2,4-difluorophenoxy)-2-(4-methylsulfonylphenyl)propanoyl]amino]pyridine-3-carboxylic acid is CC(Oc1ccc(F)cc1F)(C(=O)Nc1ccc(C(=O)O)cn1)c1ccc(S(C)(=O)=O)cc1.
What is the InChIKey of 6-[[2-(2,4-difluorophenoxy)-2-(4-methylsulfonylphenyl)propanoyl]amino]pyridine-3-carboxylic acid?
The InChIKey is IXAXKBRQLYHOEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18F2N2O6S/c1-22(32-18-9-6-15(23)11-17(18)24,14-4-7-16(8-5-14)33(2,30)31)21(29)26-19-10-3-13(12-25-19)20(27)28/h3-12H,1-2H3,(H,27,28)(H,25,26,29).
What are the key properties of 6-[[2-(2,4-difluorophenoxy)-2-(4-methylsulfonylphenyl)propanoyl]amino]pyridine-3-carboxylic acid?
6-[[2-(2,4-difluorophenoxy)-2-(4-methylsulfonylphenyl)propanoyl]amino]pyridine-3-carboxylic acid has a molecular weight of 476.46 g/mol, XLogP of 3.39, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[2-(2,4-difluorophenoxy)-2-(4-methylsulfonylphenyl)propanoyl]amino]pyridine-3-carboxylic acid is sourced from PubChem (CID 59363818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).