C16H16N6S2 — CID 59363910
N,N'-bis(4-thiophen-2-yl-1H-pyrazol-5-yl)ethane-1,2-diamine (PubChem CID 59363910) has the molecular formula C16H16N6S2 and a molecular weight of 356.48 g/mol. Its IUPAC name is N,N'-bis(4-thiophen-2-yl-1H-pyrazol-5-yl)ethane-1,2-diamine.
| Compound Name | N,N'-bis(4-thiophen-2-yl-1H-pyrazol-5-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 59363910 |
| Molecular Formula | C16H16N6S2 |
| Molecular Weight | 356.48 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | N,N'-bis(4-thiophen-2-yl-1H-pyrazol-5-yl)ethane-1,2-diamine |
| SMILES | c1csc(-c2cn[nH]c2NCCNc2[nH]ncc2-c2cccs2)c1 |
| InChI | InChI=1S/C16H16N6S2/c1-3-13(23-7-1)11-9-19-21-15(11)17-5-6-18-16-12(10-20-22-16)14-4-2-8-24-14/h1-4,7-10H,5-6H2,(H2,17,19,21)(H2,18,20,22) |
| InChIKey | GABBKIBWHFPAJY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|