C28H41NO3SSn — CID 59364221
tributyl-[5-methoxy-1-(4-methylphenyl)sulfonylindol-3-yl]stannane (PubChem CID 59364221) has the molecular formula C28H41NO3SSn and a molecular weight of 590.42 g/mol. Its IUPAC name is tributyl-[5-methoxy-1-(4-methylphenyl)sulfonylindol-3-yl]stannane.
| Compound Name | tributyl-[5-methoxy-1-(4-methylphenyl)sulfonylindol-3-yl]stannane |
|---|---|
| PubChem CID | 59364221 |
| Molecular Formula | C28H41NO3SSn |
| Molecular Weight | 590.42 g/mol |
| Exact Mass | 591.18 |
| IUPAC Name | tributyl-[5-methoxy-1-(4-methylphenyl)sulfonylindol-3-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cn(S(=O)(=O)c2ccc(C)cc2)c2ccc(OC)cc12 |
| InChI | InChI=1S/C16H14NO3S.3C4H9.Sn/c1-12-3-6-15(7-4-12)21(18,19)17-10-9-13-11-14(20-2)5-8-16(13)17;3*1-3-4-2;/h3-8,10-11H,1-2H3;3*1,3-4H2,2H3; |
| InChIKey | HTTFFUDAMUBEST-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.42 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |