C28H34NO4S2+ — CID 59364401
[2-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethyl-(3-phenoxypropyl)azanium (PubChem CID 59364401) has the molecular formula C28H34NO4S2+ and a molecular weight of 512.72 g/mol. Its IUPAC name is [2-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethyl-(3-phenoxypropyl)azanium.
| Compound Name | [2-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethyl-(3-phenoxypropyl)azanium |
|---|---|
| PubChem CID | 59364401 |
| Molecular Formula | C28H34NO4S2+ |
| Molecular Weight | 512.72 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | [2-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethyl-(3-phenoxypropyl)azanium |
| SMILES | C[N+](C)(CCCOc1ccccc1)C1C2CCC1C(OC(=O)C(O)(c1cccs1)c1cccs1)C2 |
| InChI | InChI=1S/C28H34NO4S2/c1-29(2,15-8-16-32-21-9-4-3-5-10-21)26-20-13-14-22(26)23(19-20)33-27(30)28(31,24-11-6-17-34-24)25-12-7-18-35-25/h3-7,9-12,17-18,20,22-23,26,31H,8,13-16,19H2,1-2H3/q+1 |
| InChIKey | BFIVXLVTYVOHFB-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.72 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|