C19H34N2O10 — CID 59364476
[(2S,3R,4S,6R)-4,6-dimethoxy-2-methyloxan-3-yl]carbamoyloxymethyl N-[(2S,3R,4S,6R)-4,6-dimethoxy-2-methyloxan-3-yl]carbamate (PubChem CID 59364476) has the molecular formula C19H34N2O10 and a molecular weight of 450.49 g/mol. Its IUPAC name is [(2S,3R,4S,6R)-4,6-dimethoxy-2-methyloxan-3-yl]carbamoyloxymethyl N-[(2S,3R,4S,6R)-4,6-dimethoxy-2-methyloxan-3-yl]carbamate.
| Compound Name | [(2S,3R,4S,6R)-4,6-dimethoxy-2-methyloxan-3-yl]carbamoyloxymethyl N-[(2S,3R,4S,6R)-4,6-dimethoxy-2-methyloxan-3-yl]carbamate |
|---|---|
| PubChem CID | 59364476 |
| Molecular Formula | C19H34N2O10 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | [(2S,3R,4S,6R)-4,6-dimethoxy-2-methyloxan-3-yl]carbamoyloxymethyl N-[(2S,3R,4S,6R)-4,6-dimethoxy-2-methyloxan-3-yl]carbamate |
| SMILES | CO[C@H]1C[C@H](OC)[C@H](NC(=O)OCOC(=O)N[C@@H]2[C@H](C)O[C@@H](OC)C[C@@H]2OC)[C@H](C)O1 |
| InChI | InChI=1S/C19H34N2O10/c1-10-16(12(24-3)7-14(26-5)30-10)20-18(22)28-9-29-19(23)21-17-11(2)31-15(27-6)8-13(17)25-4/h10-17H,7-9H2,1-6H3,(H,20,22)(H,21,23)/t10-,11-,12-,13-,14+,15+,16+,17+/m0/s1 |
| InChIKey | NEEHHKSJCVVYGD-MPVNCORWSA-N |
| XLogP | 0.73 |
| TPSA | 132.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|