C19H44O2Si2 — CID 59364656
ethoxy-[7-[ethoxy(dimethyl)silyl]-3,3,5,5-tetramethylheptyl]-dimethylsilane (PubChem CID 59364656) has the molecular formula C19H44O2Si2 and a molecular weight of 360.73 g/mol. Its IUPAC name is ethoxy-[7-[ethoxy(dimethyl)silyl]-3,3,5,5-tetramethylheptyl]-dimethylsilane.
| Compound Name | ethoxy-[7-[ethoxy(dimethyl)silyl]-3,3,5,5-tetramethylheptyl]-dimethylsilane |
|---|---|
| PubChem CID | 59364656 |
| Molecular Formula | C19H44O2Si2 |
| Molecular Weight | 360.73 g/mol |
| Exact Mass | 360.29 |
| IUPAC Name | ethoxy-[7-[ethoxy(dimethyl)silyl]-3,3,5,5-tetramethylheptyl]-dimethylsilane |
| SMILES | CCO[Si](C)(C)CCC(C)(C)CC(C)(C)CC[Si](C)(C)OCC |
| InChI | InChI=1S/C19H44O2Si2/c1-11-20-22(7,8)15-13-18(3,4)17-19(5,6)14-16-23(9,10)21-12-2/h11-17H2,1-10H3 |
| InChIKey | XBHDCGVBFLBVGW-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.73 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|