C17H40O2Si2 — CID 59364657
ethoxy-[5-[ethoxy(dimethyl)silyl]-2,2,4,4-tetramethylpentyl]-dimethylsilane (PubChem CID 59364657) has the molecular formula C17H40O2Si2 and a molecular weight of 332.68 g/mol. Its IUPAC name is ethoxy-[5-[ethoxy(dimethyl)silyl]-2,2,4,4-tetramethylpentyl]-dimethylsilane.
| Compound Name | ethoxy-[5-[ethoxy(dimethyl)silyl]-2,2,4,4-tetramethylpentyl]-dimethylsilane |
|---|---|
| PubChem CID | 59364657 |
| Molecular Formula | C17H40O2Si2 |
| Molecular Weight | 332.68 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | ethoxy-[5-[ethoxy(dimethyl)silyl]-2,2,4,4-tetramethylpentyl]-dimethylsilane |
| SMILES | CCO[Si](C)(C)CC(C)(C)CC(C)(C)C[Si](C)(C)OCC |
| InChI | InChI=1S/C17H40O2Si2/c1-11-18-20(7,8)14-16(3,4)13-17(5,6)15-21(9,10)19-12-2/h11-15H2,1-10H3 |
| InChIKey | YSOXMZYWSFUEPZ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.68 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|