C43H30F6N4 — CID 59364976
2-[4-[6-[1,1,1,3,3,3-hexafluoro-2-[2-(4-methylphenyl)-3H-indol-6-yl]propan-2-yl]-3H-indol-2-yl]phenyl]-6-methyl-3,5-dihydropyrrolo[3,2-f]indole (PubChem CID 59364976) has the molecular formula C43H30F6N4 and a molecular weight of 716.73 g/mol. Its IUPAC name is 2-[4-[6-[1,1,1,3,3,3-hexafluoro-2-[2-(4-methylphenyl)-3H-indol-6-yl]propan-2-yl]-3H-indol-2-yl]phenyl]-6-methyl-3,5-dihydropyrrolo[3,2-f]indole.
| Compound Name | 2-[4-[6-[1,1,1,3,3,3-hexafluoro-2-[2-(4-methylphenyl)-3H-indol-6-yl]propan-2-yl]-3H-indol-2-yl]phenyl]-6-methyl-3,5-dihydropyrrolo[3,2-f]indole |
|---|---|
| PubChem CID | 59364976 |
| Molecular Formula | C43H30F6N4 |
| Molecular Weight | 716.73 g/mol |
| Exact Mass | 716.24 |
| IUPAC Name | 2-[4-[6-[1,1,1,3,3,3-hexafluoro-2-[2-(4-methylphenyl)-3H-indol-6-yl]propan-2-yl]-3H-indol-2-yl]phenyl]-6-methyl-3,5-dihydropyrrolo[3,2-f]indole |
| SMILES | CC1=Nc2cc3c(cc2C1)CC(c1ccc(C2=Nc4cc(C(c5ccc6c(c5)N=C(c5ccc(C)cc5)C6)(C(F)(F)F)C(F)(F)F)ccc4C2)cc1)=N3 |
| InChI | InChI=1S/C43H30F6N4/c1-23-3-5-25(6-4-23)34-17-28-11-13-32(20-37(28)51-34)41(42(44,45)46,43(47,48)49)33-14-12-29-18-35(52-38(29)21-33)26-7-9-27(10-8-26)36-19-31-16-30-15-24(2)50-39(30)22-40(31)53-36/h3-14,16,20-22H,15,17-19H2,1-2H3 |
| InChIKey | PHPIMHJUZUABKA-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.73 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |