C35H34ClN3O11 — CID 59365048
methyl (2S,3S,4S,5R)-3,4,5-triacetyloxy-6-[[(1S)-3-(5-amino-1H-indole-2-carbonyl)-1-(chloromethyl)-1,2-dihydrobenzo[e]indol-5-yl]oxy]oxane-2-carboxylate (PubChem CID 59365048) has the molecular formula C35H34ClN3O11 and a molecular weight of 708.12 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R)-3,4,5-triacetyloxy-6-[[(1S)-3-(5-amino-1H-indole-2-carbonyl)-1-(chloromethyl)-1,2-dihydrobenzo[e]indol-5-yl]oxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R)-3,4,5-triacetyloxy-6-[[(1S)-3-(5-amino-1H-indole-2-carbonyl)-1-(chloromethyl)-1,2-dihydrobenzo[e]indol-5-yl]oxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 59365048 |
| Molecular Formula | C35H34ClN3O11 |
| Molecular Weight | 708.12 g/mol |
| Exact Mass | 707.19 |
| IUPAC Name | methyl (2S,3S,4S,5R)-3,4,5-triacetyloxy-6-[[(1S)-3-(5-amino-1H-indole-2-carbonyl)-1-(chloromethyl)-1,2-dihydrobenzo[e]indol-5-yl]oxy]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1OC(Oc2cc3c(c4ccccc24)[C@H](CCl)CN3C(=O)c2cc3cc(N)ccc3[nH]2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C35H34ClN3O11/c1-16(40)46-29-30(47-17(2)41)32(48-18(3)42)35(50-31(29)34(44)45-4)49-27-13-26-28(23-8-6-5-7-22(23)27)20(14-36)15-39(26)33(43)25-12-19-11-21(37)9-10-24(19)38-25/h5-13,20,29-32,35,38H,14-15,37H2,1-4H3/t20-,29+,30+,31+,32-,35?/m1/s1 |
| InChIKey | VVFBQNVSSKCFQA-AOJJUDLMSA-N |
| XLogP | 3.96 |
| TPSA | 185.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.12 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|