C22H34O2 — CID 59365098
[(1S,7S,8S,8aR)-8-[(E)-3,3-dimethylbut-1-enyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate (PubChem CID 59365098) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is [(1S,7S,8S,8aR)-8-[(E)-3,3-dimethylbut-1-enyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate.
| Compound Name | [(1S,7S,8S,8aR)-8-[(E)-3,3-dimethylbut-1-enyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate |
|---|---|
| PubChem CID | 59365098 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | [(1S,7S,8S,8aR)-8-[(E)-3,3-dimethylbut-1-enyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate |
| SMILES | CC[C@H](C)C(=O)O[C@H]1CCC=C2C=C[C@H](C)[C@H](/C=C/C(C)(C)C)[C@H]21 |
| InChI | InChI=1S/C22H34O2/c1-7-15(2)21(23)24-19-10-8-9-17-12-11-16(3)18(20(17)19)13-14-22(4,5)6/h9,11-16,18-20H,7-8,10H2,1-6H3/b14-13+/t15-,16-,18-,19-,20-/m0/s1 |
| InChIKey | ADQNHRVQJXTRHT-PXRHNPNCSA-N |
| XLogP | 5.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|