About 1-ethyl-4,5-dimethoxy-N-(6-piperazin-1-yl-3-pyridinyl)indole-2-carboxamide
1-ethyl-4,5-dimethoxy-N-(6-piperazin-1-yl-3-pyridinyl)indole-2-carboxamide (PubChem CID 59365140) has the molecular formula C22H27N5O3
and a molecular weight of 409.49 g/mol. Its IUPAC name is 1-ethyl-4,5-dimethoxy-N-(6-piperazin-1-yl-3-pyridinyl)indole-2-carboxamide.
Molecular Properties
| Compound Name | 1-ethyl-4,5-dimethoxy-N-(6-piperazin-1-yl-3-pyridinyl)indole-2-carboxamide |
| PubChem CID | 59365140 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 1-ethyl-4,5-dimethoxy-N-(6-piperazin-1-yl-3-pyridinyl)indole-2-carboxamide |
| SMILES | CCn1c(C(=O)Nc2ccc(N3CCNCC3)nc2)cc2c(OC)c(OC)ccc21 |
| InChI | InChI=1S/C22H27N5O3/c1-4-27-17-6-7-19(29-2)21(30-3)16(17)13-18(27)22(28)25-15-5-8-20(24-14-15)26-11-9-23-10-12-26/h5-8,13-14,23H,4,9-12H2,1-3H3,(H,25,28) |
| InChIKey | PYHYEXWNBVDQBP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-ethyl-4,5-dimethoxy-N-(6-piperazin-1-yl-3-pyridinyl)indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4,5-dimethoxy-N-(6-piperazin-1-yl-3-pyridinyl)indole-2-carboxamide?
The IUPAC name of 1-ethyl-4,5-dimethoxy-N-(6-piperazin-1-yl-3-pyridinyl)indole-2-carboxamide (CID 59365140) is 1-ethyl-4,5-dimethoxy-N-(6-piperazin-1-yl-3-pyridinyl)indole-2-carboxamide.
What is the SMILES notation for 1-ethyl-4,5-dimethoxy-N-(6-piperazin-1-yl-3-pyridinyl)indole-2-carboxamide?
The canonical SMILES for 1-ethyl-4,5-dimethoxy-N-(6-piperazin-1-yl-3-pyridinyl)indole-2-carboxamide is CCn1c(C(=O)Nc2ccc(N3CCNCC3)nc2)cc2c(OC)c(OC)ccc21.
What is the InChIKey of 1-ethyl-4,5-dimethoxy-N-(6-piperazin-1-yl-3-pyridinyl)indole-2-carboxamide?
The InChIKey is PYHYEXWNBVDQBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N5O3/c1-4-27-17-6-7-19(29-2)21(30-3)16(17)13-18(27)22(28)25-15-5-8-20(24-14-15)26-11-9-23-10-12-26/h5-8,13-14,23H,4,9-12H2,1-3H3,(H,25,28).
What are the key properties of 1-ethyl-4,5-dimethoxy-N-(6-piperazin-1-yl-3-pyridinyl)indole-2-carboxamide?
1-ethyl-4,5-dimethoxy-N-(6-piperazin-1-yl-3-pyridinyl)indole-2-carboxamide has a molecular weight of 409.49 g/mol, XLogP of 2.74, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4,5-dimethoxy-N-(6-piperazin-1-yl-3-pyridinyl)indole-2-carboxamide is sourced from PubChem (CID 59365140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).