C19H21ClN4O2 — CID 59365159
5-chloro-N-[6-[2-methoxyethyl(methyl)amino]-3-pyridinyl]-1-methylindole-2-carboxamide (PubChem CID 59365159) has the molecular formula C19H21ClN4O2 and a molecular weight of 372.86 g/mol. Its IUPAC name is 5-chloro-N-[6-[2-methoxyethyl(methyl)amino]-3-pyridinyl]-1-methylindole-2-carboxamide.
| Compound Name | 5-chloro-N-[6-[2-methoxyethyl(methyl)amino]-3-pyridinyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 59365159 |
| Molecular Formula | C19H21ClN4O2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 5-chloro-N-[6-[2-methoxyethyl(methyl)amino]-3-pyridinyl]-1-methylindole-2-carboxamide |
| SMILES | COCCN(C)c1ccc(NC(=O)c2cc3cc(Cl)ccc3n2C)cn1 |
| InChI | InChI=1S/C19H21ClN4O2/c1-23(8-9-26-3)18-7-5-15(12-21-18)22-19(25)17-11-13-10-14(20)4-6-16(13)24(17)2/h4-7,10-12H,8-9H2,1-3H3,(H,22,25) |
| InChIKey | UZCZCJGNTUOSJE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |