C23H27F17O4 — CID 59366445
1-[2-[[3-(1,1-difluoroethyl)-4-ethyl-2,2,3-trifluoro-1-(trifluoromethyl)cyclopentyl]oxymethoxy]ethoxymethoxy]-4-ethyl-2,2,3-trifluoro-1,3-bis(trifluoromethyl)cyclopentane (PubChem CID 59366445) has the molecular formula C23H27F17O4 and a molecular weight of 690.43 g/mol. Its IUPAC name is 1-[2-[[3-(1,1-difluoroethyl)-4-ethyl-2,2,3-trifluoro-1-(trifluoromethyl)cyclopentyl]oxymethoxy]ethoxymethoxy]-4-ethyl-2,2,3-trifluoro-1,3-bis(trifluoromethyl)cyclopentane.
| Compound Name | 1-[2-[[3-(1,1-difluoroethyl)-4-ethyl-2,2,3-trifluoro-1-(trifluoromethyl)cyclopentyl]oxymethoxy]ethoxymethoxy]-4-ethyl-2,2,3-trifluoro-1,3-bis(trifluoromethyl)cyclopentane |
|---|---|
| PubChem CID | 59366445 |
| Molecular Formula | C23H27F17O4 |
| Molecular Weight | 690.43 g/mol |
| Exact Mass | 690.16 |
| IUPAC Name | 1-[2-[[3-(1,1-difluoroethyl)-4-ethyl-2,2,3-trifluoro-1-(trifluoromethyl)cyclopentyl]oxymethoxy]ethoxymethoxy]-4-ethyl-2,2,3-trifluoro-1,3-bis(trifluoromethyl)cyclopentane |
| SMILES | CCC1CC(OCOCCOCOC2(C(F)(F)F)CC(CC)C(F)(C(F)(F)F)C2(F)F)(C(F)(F)F)C(F)(F)C1(F)C(C)(F)F |
| InChI | InChI=1S/C23H27F17O4/c1-4-12-8-15(21(32,33)34,19(28,29)17(12,26)14(3,24)25)43-10-41-6-7-42-11-44-16(22(35,36)37)9-13(5-2)18(27,20(16,30)31)23(38,39)40/h12-13H,4-11H2,1-3H3 |
| InChIKey | IGQMTAYZSITETK-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.43 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|