C13H27N — CID 59366450
N,N,2,3,4,5,5-heptamethylhex-3-en-2-amine (PubChem CID 59366450) has the molecular formula C13H27N and a molecular weight of 197.37 g/mol. Its IUPAC name is N,N,2,3,4,5,5-heptamethylhex-3-en-2-amine.
| Compound Name | N,N,2,3,4,5,5-heptamethylhex-3-en-2-amine |
|---|---|
| PubChem CID | 59366450 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | N,N,2,3,4,5,5-heptamethylhex-3-en-2-amine |
| SMILES | CC(=C(C)C(C)(C)N(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H27N/c1-10(12(3,4)5)11(2)13(6,7)14(8)9/h1-9H3 |
| InChIKey | FABYXMQANMESCI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|